
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 69614-95-5 |
| Catalog No. | 2A-9085174 |
| Chinese Name | 4′-(2-氯乙基)苯乙酮 |
| Synonyms | 1-[4-(2-chloroethyl)phenyl]ethanone; MFCD00016350 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 288.30 |
| Density | 1,15 g/cm3 |
| Boiling Point | 112°C 0,1mm |
| Appearance | solid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2914700090 |
| PubChem ID | 329815582 |
| MDL Number | MFCD00597841 |
| SMILES | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1OC |
| InChI | 1S/C16H16O5/c1-20-15-6-3-10(8-16(15)21-2)7-13(18)12-5-4-11(17)9-14(12)19/h3-6,8-9,17,19H,7H2,1-2H3 |
| InChI Key | LRXMMYWDVBYTPO-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/85174_1_69614_95_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Acetamido-2-deoxy-D-galactopyranose | 14215-68-0 | 2A-9085166 |
| 4-Acetylbenzenesulfonicacidsodiumsalt | 61827-67-6 | 2A-9085167 |
| 4-Phenylazophenacylbromide | 62625-24-5 | 2A-9085169 |
| 2-Methyl-6-nitrobenzoylchloride | 66232-57-3 | 2A-9085171 |
| Benzoinisopropylether | 6652-28-4 | 2A-9085173 |
| 2-Acetamido-2-deoxy-beta-D-glucopyranosylamine | 18615-50-4 | 2A-9085183 |
| 4-(4-Oxo-2-thioxothiazolidin-3-yl)butanoicacid | 18623-60-4 | 2A-9085184 |
| 4-Methoxy-3-nitrobenzamide | 10397-58-7 | 2A-9085189 |
| Acetobromo-alpha-D-glucuronic acid methyl ester | 21085-72-3 | 2A-9085190 |
| 5-Chloro-2-nitrobenzamide | 40763-96-0 | 2A-9085191 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA