
CAS Number61827-67-6
Synonymssodium 4-ethanoylbenzenesulfonate; EINECS 263-259-0; 4-acetyl-benzenesulphonic acid sodium salt; Sodium 4-acetylbenzenesulphonate; sodium 4-acetylbenzene sulfonate; sodium p-acetylbenzenesulfonate; 4-acetylbenzenesulfonic acid sodium salt
Molecular FormulaC8H7NaO4S
Molecular Weight222.19400
Melting Point300ºC
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61827-67-6 |
| Catalog No. | 2A-9085167 |
| Chinese Name | 4-乙酰基苯磺酸钠盐 |
| Synonyms | sodium 4-ethanoylbenzenesulfonate; EINECS 263-259-0; 4-acetyl-benzenesulphonic acid sodium salt; Sodium 4-acetylbenzenesulphonate; sodium 4-acetylbenzene sulfonate; sodium p-acetylbenzenesulfonate; 4-acetylbenzenesulfonic acid sodium salt |
| Molecular Formula | C8H7NaO4S |
| Molecular Weight | 222.19400 |
| Melting Point | 300ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2914399090 |
| SMILES | [Na+].CC(=O)c1ccc(cc1)[S]([O-])(=O)=O |
| InChI | InChI=1S/C8H8O4S.Na/c1-6(9)7-2-4-8(5-3-7)13(10,11)12;/h2-5H,1H3,(H,10,11,12);/q;+1/p-1 |
| InChI Key | InChIKey=PUWCULQGLSPCMQ-UHFFFAOYSA-M |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(2-Thenoyl)propionicacid | 4653-08-1 | 2A-9085154 |
| Cinnamylideneacetophenone | 614-57-3 | 2A-9085163 |
| 3-Acetamido-3-deoxy-D-glucose | 14086-88-5 | 2A-9085164 |
| 4'-Methyl-2(p-tolylsulfonyl)acetophenone | 61820-95-9 | 2A-9085165 |
| 2-Acetamido-2-deoxy-D-galactopyranose | 14215-68-0 | 2A-9085166 |
| 4-Phenylazophenacylbromide | 62625-24-5 | 2A-9085169 |
| 2-Methyl-6-nitrobenzoylchloride | 66232-57-3 | 2A-9085171 |
| Benzoinisopropylether | 6652-28-4 | 2A-9085173 |
| 4-(2-Chloroethyl)acetophenone | 69614-95-5 | 2A-9085174 |
| 2-Acetamido-2-deoxy-beta-D-glucopyranosylamine | 18615-50-4 | 2A-9085183 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA