
CAS Number62625-24-5
Synonyms4-Phenylazophenacyl Bromide; p-Phenylazophenacylbromid
Molecular FormulaC14H11BrN2O
Molecular Weight303.15400
Density1.37g/cm3
Boiling Point427ºC at 760mmHg
Melting Point104ºC
AppearanceSolid;White to Yellow to Orange powder to crystal
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 62625-24-5 |
| Catalog No. | 2A-9085169 |
| Chinese Name | 4-苯基偶氮苯乙酰溴 |
| Synonyms | 4-Phenylazophenacyl Bromide; p-Phenylazophenacylbromid |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.15400 |
| Density | 1.37g/cm3 |
| Boiling Point | 427ºC at 760mmHg |
| Melting Point | 104ºC |
| Appearance | Solid;White to Yellow to Orange powder to crystal |
| Storage Condition | Store in inert gas; protect from light, air |
| Packaging | III |
| HTC | 2927000090 |
| SMILES | O=C(CBr)c1ccc(N=Nc2ccccc2)cc1 |
| InChI | InChI=1S/C14H11BrN2O/c15-10-14(18)11-6-8-13(9-7-11)17-16-12-4-2-1-3-5-12/h1-9H,10H2 |
| InChI Key | ZXTGCMLCYPYCID-UHFFFAOYSA-N |
| Hazard Symbols | Category 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 1759 Proper shipping name: Corrosive solid, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cinnamylideneacetophenone | 614-57-3 | 2A-9085163 |
| 3-Acetamido-3-deoxy-D-glucose | 14086-88-5 | 2A-9085164 |
| 4'-Methyl-2(p-tolylsulfonyl)acetophenone | 61820-95-9 | 2A-9085165 |
| 2-Acetamido-2-deoxy-D-galactopyranose | 14215-68-0 | 2A-9085166 |
| 4-Acetylbenzenesulfonicacidsodiumsalt | 61827-67-6 | 2A-9085167 |
| 2-Methyl-6-nitrobenzoylchloride | 66232-57-3 | 2A-9085171 |
| Benzoinisopropylether | 6652-28-4 | 2A-9085173 |
| 4-(2-Chloroethyl)acetophenone | 69614-95-5 | 2A-9085174 |
| 2-Acetamido-2-deoxy-beta-D-glucopyranosylamine | 18615-50-4 | 2A-9085183 |
| 4-(4-Oxo-2-thioxothiazolidin-3-yl)butanoicacid | 18623-60-4 | 2A-9085184 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA