
CAS Number85068-34-4
SynonymsMFCD00009911; 3′,5′-Bis(trifluoromethyl)propiophenone; EINECS 285-296-1; FXFFR CV2 EXFFF; 1-[3,5-bis(trifluoromethyl)phenyl]propan-1-one; 1-[3,5-Bis(trifluoromethyl)phenyl]-1-propanone
Molecular FormulaC11H8O1F6
Molecular Weight270.17
Density1.3±0.1 g/cm3
Boiling Point185.2±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 85068-34-4 |
| Catalog No. | 2A-9085096 |
| Chinese Name | 3',5'-双(三氟甲基)苯乙酮 |
| Synonyms | MFCD00009911; 3′,5′-Bis(trifluoromethyl)propiophenone; EINECS 285-296-1; FXFFR CV2 EXFFF; 1-[3,5-bis(trifluoromethyl)phenyl]propan-1-one; 1-[3,5-Bis(trifluoromethyl)phenyl]-1-propanone |
| Molecular Formula | C11H8O1F6 |
| Molecular Weight | 270.17 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 185.2±35.0 °C at 760 mmHg |
| Storage Condition | Sealed, cool, dry place |
| HTC | 2914700090 |
| MDL Number | MFCD00009911 |
| SMILES | CCC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F6O/c1-2-9(18)6-3-7(10(12,13)14)5-8(4-6)11(15,16)17/h3-5H,2H2,1H3 |
| InChI Key | VLRWCHKOSBUGMB-UHFFFAOYSA-N |
| MSDS | msds/85096_1_85068_34_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,3'-Bis(trifluoromethyl)benzophenone | 1868-00-4 | 2A-9085091 |
| 3',5'-Bis(trifluoromethyl)-2-bromoacetophenone | 131805-94-2 | 2A-9085092 |
| 2,2-Bis(trifluoromethyl)-2-hydroxyaceticacid | 662-22-6 | 2A-9085093 |
| 3,5-Bis(trifluoromethyl)mandelicacid | 228107-82-2 | 2A-9085094 |
| 1-[3,5-Bis(trifluoromethyl)phenyl]-2-thiourea | 175277-17-5 | 2A-9085095 |
| 3-Bromophenyltrifluoromethylsulfide | 2252-45-1 | 2A-9085098 |
| 2-Bromo-5-(trifluoromethyl)benzenesulfonylchloride | 176225-08-4 | 2A-9085099 |
| N-Chloroacetyl-3,5-bis(trifluoromethyl)aniline | 790-75-0 | 2A-9085103 |
| N-Fluoro-4,6-bis(trifluoromethyl)pyridinium-2-sulfonate | 147541-03-5 | 2A-9085106 |
| 1,4-Cyclohexanedicarbohydrazide | 27327-67-9 | 2A-9085107 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA