
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 228107-82-2 |
| Catalog No. | 2A-9085094 |
| Chinese Name | 3,5-双(三氟甲基)扁桃酸 |
| Molecular Formula | (CF3)2C6H3SH |
| Molecular Weight | 246.17 |
| Purity | 97 |
| Density | 1.581g/cm3 |
| Boiling Point | 167 °C (lit.) |
| HTC | 2918199090 |
| PubChem ID | 24878135 |
| MDL Number | MFCD00042273 |
| SMILES | FC(F)(F)c1cc(S)cc(c1)C(F)(F)F |
| InChI | 1S/C8H4F6S/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h1-3,15H |
| InChI Key | KCAQWPZIMLLEAF-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/85094_1_228107_82_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1-Bromooctafluoro-1-(trifluoromethyl)cyclopentane | 125112-68-7 | 2A-9085076 |
| 3,4'-Bis(trifluoromethyl)benzhydrol | 203915-48-4 | 2A-9085090 |
| 3,3'-Bis(trifluoromethyl)benzophenone | 1868-00-4 | 2A-9085091 |
| 3',5'-Bis(trifluoromethyl)-2-bromoacetophenone | 131805-94-2 | 2A-9085092 |
| 2,2-Bis(trifluoromethyl)-2-hydroxyaceticacid | 662-22-6 | 2A-9085093 |
| 1-[3,5-Bis(trifluoromethyl)phenyl]-2-thiourea | 175277-17-5 | 2A-9085095 |
| 3',5'-Bis(trifluoromethyl)propiophenone | 85068-34-4 | 2A-9085096 |
| 3-Bromophenyltrifluoromethylsulfide | 2252-45-1 | 2A-9085098 |
| 2-Bromo-5-(trifluoromethyl)benzenesulfonylchloride | 176225-08-4 | 2A-9085099 |
| N-Chloroacetyl-3,5-bis(trifluoromethyl)aniline | 790-75-0 | 2A-9085103 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA