
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1868-00-4 |
| Catalog No. | 2A-9085091 |
| Chinese Name | 3,3'-双(三氟甲基)苯甲酮 |
| Synonyms | MFCD00000390; 3,3'-Bis(trifluoroMethyl)benzophenone; 3,3'-ditrifluormethylbenzophenone |
| Molecular Formula | C15H8F6O |
| Molecular Weight | 318.21400 |
| Density | 1.356g/cm3 |
| Boiling Point | 328.6ºC at 760mmHg |
| Melting Point | 100-102 °C(lit.) |
| Appearance | yellow crystal powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914700090 |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8F6O/c16-14(17,18)11-5-1-3-9(7-11)13(22)10-4-2-6-12(8-10)15(19,20)21/h1-8H |
| InChI Key | POOXOHISLGOAEF-UHFFFAOYSA-N |
| MSDS | msds/85091_1_1868_00_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3,3'-Bis(trifluoromethyl)benzophenone Modification number: 6 |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Chloromethylbenzenesulfonylfluoride | 455-21-0 | 2A-9085028 |
| 4-(2H-Tetrazol-5-yl)benzaldehyde | 74815-22-8 | 2A-9085034 |
| (4-Phthalimidomethylphenyl)boronicacid,pinacolester | 138500-87-5 | 2A-9085046 |
| 1-Bromooctafluoro-1-(trifluoromethyl)cyclopentane | 125112-68-7 | 2A-9085076 |
| 3,4'-Bis(trifluoromethyl)benzhydrol | 203915-48-4 | 2A-9085090 |
| 3',5'-Bis(trifluoromethyl)-2-bromoacetophenone | 131805-94-2 | 2A-9085092 |
| 2,2-Bis(trifluoromethyl)-2-hydroxyaceticacid | 662-22-6 | 2A-9085093 |
| 3,5-Bis(trifluoromethyl)mandelicacid | 228107-82-2 | 2A-9085094 |
| 1-[3,5-Bis(trifluoromethyl)phenyl]-2-thiourea | 175277-17-5 | 2A-9085095 |
| 3',5'-Bis(trifluoromethyl)propiophenone | 85068-34-4 | 2A-9085096 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA