
CAS Number176225-08-4
SynonymsMFCD03094395; 2-bromo-5-trifluoromethylbenzenesulfonyl chloride; 2-Bromo-5-(Trifluoromethyl)Benzenesulphonyl Chloride; 2-bromo-5-(trifluoromethyl)benzene-1-sulfonyl chloride
Molecular FormulaC7H3O2Cl1Br1S1F3
Molecular Weight323.52
Density1.854 g/mL at 25 °C(lit.)
Boiling Point230-231 °C(lit.)
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 176225-08-4 |
| Catalog No. | 2A-9085099 |
| Chinese Name | 2-溴-5-(三氟甲基)苯磺酰氯 |
| Synonyms | MFCD03094395; 2-bromo-5-trifluoromethylbenzenesulfonyl chloride; 2-Bromo-5-(Trifluoromethyl)Benzenesulphonyl Chloride; 2-bromo-5-(trifluoromethyl)benzene-1-sulfonyl chloride |
| Molecular Formula | C7H3O2Cl1Br1S1F3 |
| Molecular Weight | 323.52 |
| Density | 1.854 g/mL at 25 °C(lit.) |
| Boiling Point | 230-231 °C(lit.) |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | II |
| HTC | 2904909090 |
| MDL Number | MFCD03094395 |
| SMILES | O=S(=O)(Cl)c1cc(C(F)(F)F)ccc1Br |
| InChI Key | CBIFOAHDKKGDAC-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/85099_1_176225_08_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,2-Bis(trifluoromethyl)-2-hydroxyaceticacid | 662-22-6 | 2A-9085093 |
| 3,5-Bis(trifluoromethyl)mandelicacid | 228107-82-2 | 2A-9085094 |
| 1-[3,5-Bis(trifluoromethyl)phenyl]-2-thiourea | 175277-17-5 | 2A-9085095 |
| 3',5'-Bis(trifluoromethyl)propiophenone | 85068-34-4 | 2A-9085096 |
| 3-Bromophenyltrifluoromethylsulfide | 2252-45-1 | 2A-9085098 |
| N-Chloroacetyl-3,5-bis(trifluoromethyl)aniline | 790-75-0 | 2A-9085103 |
| N-Fluoro-4,6-bis(trifluoromethyl)pyridinium-2-sulfonate | 147541-03-5 | 2A-9085106 |
| 1,4-Cyclohexanedicarbohydrazide | 27327-67-9 | 2A-9085107 |
| 2-Chloro-3,5-bis(trifluoromethyl)aniline | 201593-90-0 | 2A-9085112 |
| (Chlorocarbonyldifluoromethyl)phosphonicaciddiethylester | 97480-49-4 | 2A-9085119 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA