
CAS Number338-03-4
Synonyms3-hydroxy-3-methyl-4,4,4-trifluorobutyric acid; MFCD00039531; rac-3-trifluoromethyl-3-hydroxy-butyric acid; 4,4,4,-Trifluor-3-hydroxy-3-methyl-buttersaeure; 4,4,4-Trifluoro-3-hydroxy-3-methylbutyric acid
Molecular FormulaC5H7O3F3
Molecular Weight172.1
Density1.3880
Boiling Point87 °C
Melting Point30 °C
AppearanceWhite to light yellow low melting point solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 338-03-4 |
| Catalog No. | 2A-9081531 |
| Chinese Name | 4,4,4-三氟-3-羟基-3-甲基丁酸 |
| Synonyms | 3-hydroxy-3-methyl-4,4,4-trifluorobutyric acid; MFCD00039531; rac-3-trifluoromethyl-3-hydroxy-butyric acid; 4,4,4,-Trifluor-3-hydroxy-3-methyl-buttersaeure; 4,4,4-Trifluoro-3-hydroxy-3-methylbutyric acid |
| Molecular Formula | C5H7O3F3 |
| Molecular Weight | 172.1 |
| Density | 1.3880 |
| Boiling Point | 87 °C |
| Melting Point | 30 °C |
| Appearance | White to light yellow low melting point solid |
| Storage Condition | room temperature, dry |
| Packaging | II |
| HTC | 2918199090 |
| MDL Number | MFCD00039531 |
| SMILES | C[C@](O)(CC([O-])=O)C(F)(F)F |
| InChI | InChI=1S/C5H7F3O3/c1-4(11,2-3(9)10)5(6,7)8/h11H,2H2,1H3,(H,9,10)/p-1/t4-/m0/s1 |
| InChI Key | InChIKey=JCJGOWYCFRASTM-BYPYZUCNSA-M |
| Hazard Symbols | 8 |
| MSDS | msds/81531_1_338_03_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2'-Fluoro-6'-(trifluoromethyl)acetophenone | 174013-29-7 | 2A-9081513 |
| 3-Fluoro-5-(trifluoromethyl)acetophenone | 202664-54-8 | 2A-9081514 |
| 2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone | 721-37-9 | 2A-9081515 |
| 4-(Trifluoromethyl)-alpha,alpha,alpha-trifluoroacetophenone | 74853-66-0 | 2A-9081516 |
| 2-(Trifluoromethyl)-2-hydroxypropionicacid | 114715-77-4 | 2A-9081529 |
| 4-Hydroxy-3-methoxyphenylboronicacidpinacolester | 269410-22-2 | 2A-9081534 |
| 2-Hydroxy-2-(trifluoromethyl)butyricacid | 114645-35-1 | 2A-9081558 |
| 3-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronicacid | 723281-57-0 | 2A-9081598 |
| 4-(3-Hydroxy-3-methylbut-1-ynyl)benzaldehydeoxime | 175203-57-3 | 2A-9081609 |
| 4-(Hydroxymethyl)benzaldehydedimethylacetal | 183057-64-9 | 2A-9081610 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA