
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 202664-54-8 |
| Catalog No. | 2A-9081514 |
| Chinese Name | 3′-氟-5′-(三氟甲基)苯乙酮 |
| Synonyms | MFCD00061250 |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.13700 |
| Density | 1.299 g/cm3 |
| Boiling Point | 180.6ºC at 760 mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2914700090 |
| SMILES | CC(=O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F4O/c1-5(14)6-2-7(9(11,12)13)4-8(10)3-6/h2-4H,1H3 |
| InChI Key | BDIYAWLPLVWTJY-UHFFFAOYSA-N |
| MSDS | msds/81514_1_202664_54_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-N,N-Dimethylbenzaldehyde | 619-22-7 | 2A-9081477 |
| 2-Fluoro-3-(trifluoromethyl)acetophenone | 207853-63-2 | 2A-9081510 |
| 2-Fluoro-4-(trifluoromethyl)acetophenone | 122023-29-4 | 2A-9081511 |
| 2-Fluoro-5-(trifluoromethyl)acetophenone | 202664-53-7 | 2A-9081512 |
| 2'-Fluoro-6'-(trifluoromethyl)acetophenone | 174013-29-7 | 2A-9081513 |
| 2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone | 721-37-9 | 2A-9081515 |
| 4-(Trifluoromethyl)-alpha,alpha,alpha-trifluoroacetophenone | 74853-66-0 | 2A-9081516 |
| 2-(Trifluoromethyl)-2-hydroxypropionicacid | 114715-77-4 | 2A-9081529 |
| 3-(Trifluoromethyl)-3-hydroxybutyricacid | 338-03-4 | 2A-9081531 |
| 4-Hydroxy-3-methoxyphenylboronicacidpinacolester | 269410-22-2 | 2A-9081534 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA