
CAS Number74853-66-0
Synonymstrifluoromethyl p-trifluoromethylphenyl ketone; 4-trifluoroacetyltrifluoromethylbenzene; p-trifluoromethylphenyl trifluoromethyl ketone
Molecular FormulaC9H4F6O
Molecular Weight242.11800
Density1.417 g/cm3
Boiling Point75ºC 20mm
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 74853-66-0 |
| Catalog No. | 2A-9081516 |
| Chinese Name | 4-(四氟甲基)-A,A,A-三氟苯乙酮 |
| Synonyms | trifluoromethyl p-trifluoromethylphenyl ketone; 4-trifluoroacetyltrifluoromethylbenzene; p-trifluoromethylphenyl trifluoromethyl ketone |
| Molecular Formula | C9H4F6O |
| Molecular Weight | 242.11800 |
| Density | 1.417 g/cm3 |
| Boiling Point | 75ºC 20mm |
| Storage Condition | room temperature |
| Packaging | III |
| HTC | 2914700090 |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H4F6O/c10-8(11,12)6-3-1-5(2-4-6)7(16)9(13,14)15/h1-4H |
| InChI Key | ZERSWRKHUIMRSN-UHFFFAOYSA-N |
| Hazard Symbols | 3.2 |
| MSDS | msds/81516_1_74853_66_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Fluoro-4-(trifluoromethyl)acetophenone | 122023-29-4 | 2A-9081511 |
| 2-Fluoro-5-(trifluoromethyl)acetophenone | 202664-53-7 | 2A-9081512 |
| 2'-Fluoro-6'-(trifluoromethyl)acetophenone | 174013-29-7 | 2A-9081513 |
| 3-Fluoro-5-(trifluoromethyl)acetophenone | 202664-54-8 | 2A-9081514 |
| 2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone | 721-37-9 | 2A-9081515 |
| 2-(Trifluoromethyl)-2-hydroxypropionicacid | 114715-77-4 | 2A-9081529 |
| 3-(Trifluoromethyl)-3-hydroxybutyricacid | 338-03-4 | 2A-9081531 |
| 4-Hydroxy-3-methoxyphenylboronicacidpinacolester | 269410-22-2 | 2A-9081534 |
| 2-Hydroxy-2-(trifluoromethyl)butyricacid | 114645-35-1 | 2A-9081558 |
| 3-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronicacid | 723281-57-0 | 2A-9081598 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA