
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 114645-35-1 |
| Catalog No. | 2A-9081558 |
| Chinese Name | 2-羟基-2-三氟甲基丁酸 |
| Synonyms | pc4863 |
| Molecular Formula | C5H7F3O3 |
| Molecular Weight | 360.29 |
| Purity | >97 |
| Density | 1.438g/cm3 |
| Boiling Point | 195-198ºC |
| Melting Point | 45-50 °C |
| Appearance | solid |
| HTC | 2918199090 |
| PubChem ID | 329764835 |
| MDL Number | MFCD18827466 |
| SMILES | CC(=C)C(=O)OC1C2CCC(C2)C1CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C15H18F6O3/c1-7(2)12(22)24-11-9-4-3-8(5-9)10(11)6-13(23,14(16,17)18)15(19,20)21/h8-11,23H,1,3-6H2,2H3 |
| InChI Key | VRGGMPGFYAQUIC-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12162002 |
| MSDS | msds/81558_1_114645_35_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,2,2-Trifluoro-3'-(trifluoromethyl)acetophenone | 721-37-9 | 2A-9081515 |
| 4-(Trifluoromethyl)-alpha,alpha,alpha-trifluoroacetophenone | 74853-66-0 | 2A-9081516 |
| 2-(Trifluoromethyl)-2-hydroxypropionicacid | 114715-77-4 | 2A-9081529 |
| 3-(Trifluoromethyl)-3-hydroxybutyricacid | 338-03-4 | 2A-9081531 |
| 4-Hydroxy-3-methoxyphenylboronicacidpinacolester | 269410-22-2 | 2A-9081534 |
| 3-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronicacid | 723281-57-0 | 2A-9081598 |
| 4-(3-Hydroxy-3-methylbut-1-ynyl)benzaldehydeoxime | 175203-57-3 | 2A-9081609 |
| 4-(Hydroxymethyl)benzaldehydedimethylacetal | 183057-64-9 | 2A-9081610 |
| 3-Methoxy-4-hydroxybenzaldehydeoxime | 2874-33-1 | 2A-9081613 |
| 3,4-Dihydroxybenzaldoxime | 3343-59-7 | 2A-9081615 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA