CAS Number24259-59-4
Synonyms6-Deoxy-D-altrose; (2S,3S,4S)-2,3,4,5-Tetrahydroxypentanal; L-Ribose; 2-Deoxy-B-D-Lyxo-Hexose; aldehydo-6-Desoxy-D-mannose; MFCD00167010; aldehydo-L-ribose; D-6-Deoxyaltrose; D-Altrose,6-deoxy; Ribose; 6-Deoxyaltrose; L-(+)-Ribos; 6-Deoxy-L-altrose; EINECS 246-110-4
Molecular FormulaC5H10O5
Molecular Weight150.13
Purity≥98 (GC)%
Density1.5±0.1 g/cm3
Boiling Point415.5±38.0 °C at 760 mmHg
Melting Point81-82 °C (lit.)
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24259-59-4 |
| Catalog No. | 2A-9008086 |
| Chinese Name | L-核糖 |
| Synonyms | 6-Deoxy-D-altrose; (2S,3S,4S)-2,3,4,5-Tetrahydroxypentanal; L-Ribose; 2-Deoxy-B-D-Lyxo-Hexose; aldehydo-6-Desoxy-D-mannose; MFCD00167010; aldehydo-L-ribose; D-6-Deoxyaltrose; D-Altrose,6-deoxy; Ribose; 6-Deoxyaltrose; L-(+)-Ribos; 6-Deoxy-L-altrose; EINECS 246-110-4 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| Purity | ≥98 (GC) |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 415.5±38.0 °C at 760 mmHg |
| Melting Point | 81-82 °C (lit.) |
| Appearance | powder |
| Water Solubility | Water solubility: soluble |
| Storage Condition | Store in a sealed, dry place filled with nitrogen |
| HTC | 2940000000 |
| PubChem ID | 24899368 |
| MDL Number | MFCD00167010 |
| SMILES | OC[C@@H]1OC(O)[C@@H](O)[C@H]1O |
| InChI | 1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5?/m0/s1 |
| InChI Key | HMFHBZSHGGEWLO-OWMBCFKOSA-N |
| Beilstein/REAXYS | 1723084 |
| NACRES Code | NA.25 |
| UNSPSC | 12352201 |
| MSDS | msds/8086_1_24259_59_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Isopropyl 3-amino-4-methyl benzoate | 21447-47-2 | 2A-9008074 |
| Isopropyl 3-aminocrotonate | 14205-46-0 | 2A-9008076 |
| Isopropyl nitrate | 1712-64-7 | 2A-9008078 |
| Isopropyl vinyl ether | 926-65-8 | 2A-9008079 |
| L-(-)-Dianisoyl-tartaric acid | 50583-51-2 | 2A-9008084 |
| L-2-Aminobutyric acid | 1492-24-6 | 2A-9008087 |
| L-2-Octanol | 5978-70-1 | 2A-9008089 |
| L-3,4-Dimethoxyphenylalanine | 55-59-4 | 2A-9008091 |
| L-4-trans-Hydroxyproline methyl ester hydrochloride salt | 40216-83-9 | 2A-9008092 |
| L-5-Hydroxytryptophan | 4350-09-8 | 2A-9008093 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS