
CAS Number1712-64-7
SynonymsNitric acid, 1-methylethyl ester; propan-2-yl nitrate; Nitric acid isopropyl; 2-nitrooxypropane; 2-Propanol nitrate; Isopropyl nitrate; isopriopyl nitrate; 1-methylethyl nitrate; Propan-2-ol nitrate; propane-2-nitrate; EINECS 216-983-6; MFCD00007041; 2-propyl nitrate; i-propyl nitrate
Molecular FormulaC16H25N5O5
Molecular Weight367.408
Purity99%
Density1.1±0.1 g/cm3
Boiling Point99.6±8.0 °C at 760 mmHg
Appearancecolorless liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1712-64-7 |
| Catalog No. | 2A-9008078 |
| Chinese Name | 硝酸异丙酯 |
| Synonyms | Nitric acid, 1-methylethyl ester; propan-2-yl nitrate; Nitric acid isopropyl; 2-nitrooxypropane; 2-Propanol nitrate; Isopropyl nitrate; isopriopyl nitrate; 1-methylethyl nitrate; Propan-2-ol nitrate; propane-2-nitrate; EINECS 216-983-6; MFCD00007041; 2-propyl nitrate; i-propyl nitrate |
| Molecular Formula | C16H25N5O5 |
| Molecular Weight | 367.408 |
| Purity | 99 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 99.6±8.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Storage precautions: Store in a ventilated, low-te |
| Packaging | II |
| HTC | 2920909090 |
| MDL Number | MFCD00035038 |
| SMILES | CC(C)O[N+](=O)[O-] |
| InChI | InChI=1S/C3H7NO3/c1-3(2)7-4(5)6/h3H,1-2H3 |
| InChI Key | GAPFWGOSHOCNBM-UHFFFAOYSA-N |
| Hazard Symbols | 3.1 |
| MSDS | msds/8078_1_1712_64_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Isonicotinic acid | 55-22-1 | 2A-9008070 |
| Isophorone | 78-59-1 | 2A-9008072 |
| Isoprene | 78-79-5 | 2A-9008073 |
| Isopropyl 3-amino-4-methyl benzoate | 21447-47-2 | 2A-9008074 |
| Isopropyl 3-aminocrotonate | 14205-46-0 | 2A-9008076 |
| Isopropyl vinyl ether | 926-65-8 | 2A-9008079 |
| L-(-)-Dianisoyl-tartaric acid | 50583-51-2 | 2A-9008084 |
| L-(+)-Ribose | 24259-59-4 | 2A-9008086 |
| L-2-Aminobutyric acid | 1492-24-6 | 2A-9008087 |
| L-2-Octanol | 5978-70-1 | 2A-9008089 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA