
CAS Number21577-50-4
Synonyms2,3-dibromo-4-oxo-but-2-enoic acid; Dibrommaleinaldehydsaeure; 2,3-dibromo-4-oxo-crotonic acid; 2,3-Dibrom-4-oxo-crotonsaeure; 2,3-Dibromo-4-Oxo-2-Butenoic Acid; 2,3-Dibromo-4-oxobut-2-enoic acid; 2,3-dibromomalealdehydic acid
Molecular FormulaC4H2Br2O3
Molecular Weight257.867
Density2.43g/cm3
Boiling Point321.8ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21577-50-4 |
| Catalog No. | 2A-9079172 |
| Chinese Name | 2,3-二溴-4-氧-2-丁烯酸 |
| Synonyms | 2,3-dibromo-4-oxo-but-2-enoic acid; Dibrommaleinaldehydsaeure; 2,3-dibromo-4-oxo-crotonic acid; 2,3-Dibrom-4-oxo-crotonsaeure; 2,3-Dibromo-4-Oxo-2-Butenoic Acid; 2,3-Dibromo-4-oxobut-2-enoic acid; 2,3-dibromomalealdehydic acid |
| Molecular Formula | C4H2Br2O3 |
| Molecular Weight | 257.867 |
| Density | 2.43g/cm3 |
| Boiling Point | 321.8ºC at 760mmHg |
| HTC | 2918300090 |
| PubChem ID | 449447 |
| MDL Number | MFCD00006964 |
| SMILES | O=CC(Br)=C(Br)C(=O)O |
| InChI | InChI=1S/C4H2Br2O3/c5-2(1-7)3(6)4(8)9/h1H,(H,8,9)/b3-2+ |
| InChI Key | NCNYEGJDGNOYJX-NSCUHMNNSA-N |
| MSDS | msds/79172_1_21577_50_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Difluoro-2-hydroxybenzoicacid | 84376-20-5 | 2A-9079162 |
| Vinyldiphenylphosphine | 2155-96-6 | 2A-9079163 |
| 5-Amino-2-chloro-4-fluorophenol | 84478-72-8 | 2A-9079166 |
| 4-Methoxy-3-nitropyridin-2-amine | 84487-08-1 | 2A-9079167 |
| 1,1-Bis(diphenylphosphino)ethylene | 84494-89-3 | 2A-9079170 |
| 2-Bromo-1-(pyrimidin-4-yl)ethanone | 845504-81-6 | 2A-9079174 |
| 5-Fluoro-2-methylbenzenethiol | 845823-03-2 | 2A-9079178 |
| 3'-Chloro-5'-fluoro-2,2,2-trifluoroacetophenone | 845823-07-6 | 2A-9079179 |
| 4-Bromoindan-2-one | 846032-36-8 | 2A-9079185 |
| Diphenylphthalate | 84-62-8 | 2A-9079189 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA