
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84478-72-8 |
| Catalog No. | 2A-9079166 |
| Chinese Name | 5-氨基-2-氯-4-氟苯酚 |
| Synonyms | 5-Amino-2-chloro-4-fluorophenol; 5-amino-2-chloro-4-fluoro-phenol |
| Molecular Formula | C6H5ClFNO |
| Molecular Weight | 161.56 |
| Purity | 97.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 271.9±35.0 °C at 760 mmHg |
| Melting Point | 157-160ºC |
| Storage Condition | 2-8°C, protected from light, stored in inert gas |
| HTC | 2922299090 |
| PubChem ID | 3220585 |
| SMILES | Nc1cc(O)c(Cl)cc1F |
| InChI | InChI=1S/C6H5ClFNO/c7-3-1-4(8)5(9)2-6(3)10/h1-2,10H,9H2 |
| InChI Key | AFZLCOLNTRPSIF-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(4-Formylphenyl)methanesulfonamide | 83922-54-7 | 2A-9079150 |
| 1-(4-Bromophenyl)-2,2,2-trifluoroethanamine | 842169-72-6 | 2A-9079156 |
| 1-(4-Aminobenzyl)Ethylenediamine-N,N,N',N'-tetraaceticacid | 84256-90-6 | 2A-9079158 |
| 3,5-Difluoro-2-hydroxybenzoicacid | 84376-20-5 | 2A-9079162 |
| Vinyldiphenylphosphine | 2155-96-6 | 2A-9079163 |
| 4-Methoxy-3-nitropyridin-2-amine | 84487-08-1 | 2A-9079167 |
| 1,1-Bis(diphenylphosphino)ethylene | 84494-89-3 | 2A-9079170 |
| 2,3-Dibromo-4-oxo-2-butenoicacid | 21577-50-4 | 2A-9079172 |
| 2-Bromo-1-(pyrimidin-4-yl)ethanone | 845504-81-6 | 2A-9079174 |
| 5-Fluoro-2-methylbenzenethiol | 845823-03-2 | 2A-9079178 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA