
CAS Number2155-96-6
Synonymsvinyl-diphenyl-phosphine; MFCD00008611; Diphenyl(vinyl)phosphine; Ethenyldiphenylphosphine; (Diphenylphosphino)ethen; diphenyl vinylphosphane; EINECS 218-459-2; Vinyldiphenylphosphine; Ethenyldiphenylphosphine Vinyldiphenylphosphine; diphenylvinyl phosphine
Molecular FormulaC14H13P
Molecular Weight212.22700
Density1.067 g/cm3
Boiling Point326.8ºC at 760 mmHg ,135ºC 3,5mm
AppearanceTransparent colorless to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2155-96-6 |
| Catalog No. | 2A-9079163 |
| Chinese Name | 乙烯基二苯基膦 |
| Synonyms | vinyl-diphenyl-phosphine; MFCD00008611; Diphenyl(vinyl)phosphine; Ethenyldiphenylphosphine; (Diphenylphosphino)ethen; diphenyl vinylphosphane; EINECS 218-459-2; Vinyldiphenylphosphine; Ethenyldiphenylphosphine Vinyldiphenylphosphine; diphenylvinyl phosphine |
| Molecular Formula | C14H13P |
| Molecular Weight | 212.22700 |
| Density | 1.067 g/cm3 |
| Boiling Point | 326.8ºC at 760 mmHg ,135ºC 3,5mm |
| Appearance | Transparent colorless to yellow liquid |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2902909090 |
| PubChem ID | 432094 |
| SMILES | C=CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13P/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2-12H,1H2 |
| InChI Key | AJVBXLXLODZUME-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 2.0%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2902909090 other aromatic hydrocarbons. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 2.0%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3,5,6-Tetramethylisonicotinamide | 215032-19-2 | 2A-9079146 |
| N-(4-Formylphenyl)methanesulfonamide | 83922-54-7 | 2A-9079150 |
| 1-(4-Bromophenyl)-2,2,2-trifluoroethanamine | 842169-72-6 | 2A-9079156 |
| 1-(4-Aminobenzyl)Ethylenediamine-N,N,N',N'-tetraaceticacid | 84256-90-6 | 2A-9079158 |
| 3,5-Difluoro-2-hydroxybenzoicacid | 84376-20-5 | 2A-9079162 |
| 5-Amino-2-chloro-4-fluorophenol | 84478-72-8 | 2A-9079166 |
| 4-Methoxy-3-nitropyridin-2-amine | 84487-08-1 | 2A-9079167 |
| 1,1-Bis(diphenylphosphino)ethylene | 84494-89-3 | 2A-9079170 |
| 2,3-Dibromo-4-oxo-2-butenoicacid | 21577-50-4 | 2A-9079172 |
| 2-Bromo-1-(pyrimidin-4-yl)ethanone | 845504-81-6 | 2A-9079174 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA