
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84376-20-5 |
| Catalog No. | 2A-9079162 |
| Chinese Name | 3,5-二氟水杨酸 |
| Synonyms | 3,5-difluoro-salicylic acid; 3,5-difluoro-2-hydroxy-benzoic Acid; PC1142 |
| Molecular Formula | C7H4F2O3 |
| Molecular Weight | 174.10200 |
| Density | 1.6g/cm3 |
| Boiling Point | 276.6ºC at 760 mmHg |
| HTC | 2918290000 |
| PubChem ID | 15935111 |
| SMILES | O=C(O)c1cc(F)cc(F)c1O |
| InChI | InChI=1S/C7H4F2O3/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,10H,(H,11,12) |
| InChI Key | GZPCNALAXFNOBT-UHFFFAOYSA-N |
| MSDS | msds/79162_1_84376_20_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Methoxy-(perfluoro-2-methyl-1-propene) | 360-53-2 | 2A-9079144 |
| 2,3,5,6-Tetramethylisonicotinamide | 215032-19-2 | 2A-9079146 |
| N-(4-Formylphenyl)methanesulfonamide | 83922-54-7 | 2A-9079150 |
| 1-(4-Bromophenyl)-2,2,2-trifluoroethanamine | 842169-72-6 | 2A-9079156 |
| 1-(4-Aminobenzyl)Ethylenediamine-N,N,N',N'-tetraaceticacid | 84256-90-6 | 2A-9079158 |
| Vinyldiphenylphosphine | 2155-96-6 | 2A-9079163 |
| 5-Amino-2-chloro-4-fluorophenol | 84478-72-8 | 2A-9079166 |
| 4-Methoxy-3-nitropyridin-2-amine | 84487-08-1 | 2A-9079167 |
| 1,1-Bis(diphenylphosphino)ethylene | 84494-89-3 | 2A-9079170 |
| 2,3-Dibromo-4-oxo-2-butenoicacid | 21577-50-4 | 2A-9079172 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA