
CAS Number1740-57-4
Synonymsbenzene-1,3-dicarboxamide; ISOPHTHALAMIDE; MFCD00014801; EINECS 217-104-9
Molecular FormulaC8H8N2O2
Molecular Weight164.16100
Density1.294g/cm3
Boiling Point430.8ºC at 760 mmHg
Melting Point268-270°C
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1740-57-4 |
| Catalog No. | 2A-9072362 |
| Chinese Name | 异邻苯二甲酰亚胺 |
| Synonyms | benzene-1,3-dicarboxamide; ISOPHTHALAMIDE; MFCD00014801; EINECS 217-104-9 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16100 |
| Density | 1.294g/cm3 |
| Boiling Point | 430.8ºC at 760 mmHg |
| Melting Point | 268-270°C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2924299090 |
| PubChem ID | 4697889 |
| SMILES | NC(=O)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C8H8N2O2/c9-7(11)5-2-1-3-6(4-5)8(10)12/h1-4H,(H2,9,11)(H2,10,12) |
| InChI Key | QZUPTXGVPYNUIT-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| methyl4-amino-3-(2-ethoxy-2-oxoethoxy)benzoate | 1096309-38-4 | 2A-9072356 |
| 3H-Naphtho[2,1-b]pyran-3-one,1,2-dihydro- | 5690-03-9 | 2A-9072357 |
| methyl3-(2-ethoxy-2-oxoethoxy)-4-nitrobenzoate | 214848-28-9 | 2A-9072358 |
| 2,4-Heptadienamide,7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxo- | 58880-19-6 | 2A-9072359 |
| Octanediamide,N1-hydroxy-N8-phenyl- | 149647-78-9 | 2A-9072360 |
| m-(Chlorosulfonyl)benzoylchloride | 4052-92-0 | 2A-9072366 |
| ethyl3-((benzyloxycarbonyl)(2-methoxy-2-oxoethyl)amino)propanoate | 1245646-09-6 | 2A-9072367 |
| methyl2-(benzyloxycarbonylamino)acetate | 158457-27-3 | 2A-9072368 |
| 2-[[4-(1,1-Dimethylethyl)cyclohexyl]methyl]-3-hydroxy-1,4-naphthalenedione | 88426-33-9 | 2A-9072370 |
| 3-methoxy-6-nitropyridin-2-ol | 1245648-51-4 | 2A-9072381 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA