
CAS Number202522-23-4
SynonymsBenzenemethanamine,2-chloro-5-fluoro; (2-chloro-5-fluorophenyl)methylamine; 2-chloro-5-fluorobenzyl amine; Z1R BG EF; 1-(2-Chloro-5-fluorophenyl)methanamine; MFCD06213626; 2-Chloro-5-fluorobenzylamine; (2-Chloro-5-fluorophenyl)methanamine 2-Chloro-5-fluorobenzenemethanamine
Molecular FormulaC7H7ClFN
Molecular Weight159.589
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point212.9±25.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 202522-23-4 |
| Catalog No. | 2A-9055251 |
| Chinese Name | 2-氯-5-氟苄胺 |
| Synonyms | Benzenemethanamine,2-chloro-5-fluoro; (2-chloro-5-fluorophenyl)methylamine; 2-chloro-5-fluorobenzyl amine; Z1R BG EF; 1-(2-Chloro-5-fluorophenyl)methanamine; MFCD06213626; 2-Chloro-5-fluorobenzylamine; (2-Chloro-5-fluorophenyl)methanamine 2-Chloro-5-fluorobenzenemethanamine |
| Molecular Formula | C7H7ClFN |
| Molecular Weight | 159.589 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 212.9±25.0 °C at 760 mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | III |
| HTC | 2921499090 |
| SMILES | NCc1cc(F)ccc1Cl |
| InChI | InChI=1S/C7H7ClFN/c8-7-2-1-6(9)3-5(7)4-10/h1-3H,4,10H2 |
| InChI Key | IGFBMQSUHFQVFE-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/55251_1_202522_23_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Amino-11-azido-3,6,9-trioxaundecane | 134179-38-7 | 2A-9052337 |
| Seocalcitol | 134404-52-7 | 2A-9052345 |
| 2-Bromo-5-nitrobenzonitrile | 134604-07-2 | 2A-9052361 |
| 4'-Chloro-3,4-dihydroxybenzophenone | 134612-84-3 | 2A-9055249 |
| 2-(2-Hexyldecyloxy)benzamide | 202483-62-3 | 2A-9055250 |
| 4-Pent-1-enylbenzoic acid | 202798-06-9 | 2A-9055254 |
| 4-Bromo-4'-(diphenylamino)biphenyl | 202831-65-0 | 2A-9055255 |
| 1-Cyclopropyl-1,3-dihydro-2H-benzimidazol-2-one | 202859-73-2 | 2A-9055256 |
| 2-Bromo-4,5-difluoroanisole | 202865-58-5 | 2A-9055257 |
| 4-Bromo-3,5-difluoroanisole | 202865-61-0 | 2A-9055260 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA