
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 134612-84-3 |
| Catalog No. | 2A-9055249 |
| Chinese Name | 4'-氯-3,4-二羟基二苯甲酮 |
| Synonyms | 4'-CHLORO-3,4-DIHYDROXYBENZOPHENONE; 4-chloro-3',4'-dihydroxydiphenylmethanone |
| Molecular Formula | C13H9ClO3 |
| Molecular Weight | 309.55 |
| Purity | 98.00 |
| Density | 1.41g/cm3 |
| Boiling Point | 468.771ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | Room temperature, store in inert gas |
| HTC | 2914700090 |
| PubChem ID | 329816088 |
| MDL Number | MFCD11104746 |
| SMILES | Clc1ncnc2n(ncc12)-c3ccc(Br)cc3 |
| InChI | 1S/C11H6BrClN4/c12-7-1-3-8(4-2-7)17-11-9(5-16-17)10(13)14-6-15-11/h1-6H |
| InChI Key | UZYNDGAOOONELP-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/55249_1_134612_84_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N,N'-Bis(2,6-diisopropylphenyl)ethylenediamine | 134030-22-1 | 2A-9052325 |
| 2-[2-[2-Chloro-3-[2-(1,3-dihydro-1,1,3-trimethyl-2H-benz[e]indol-2-ylidene)ethylidene]-1-cyclohexen-1-yl]ethenyl]-1,1,3-trimethyl-1H-benz[e]indolium salt with 4-methylbenzenesulfonate (1:1) | 134127-48-3 | 2A-9052334 |
| 1-Amino-11-azido-3,6,9-trioxaundecane | 134179-38-7 | 2A-9052337 |
| Seocalcitol | 134404-52-7 | 2A-9052345 |
| 2-Bromo-5-nitrobenzonitrile | 134604-07-2 | 2A-9052361 |
| 2-(2-Hexyldecyloxy)benzamide | 202483-62-3 | 2A-9055250 |
| 2-Chloro-5-fluorobenzylamine | 202522-23-4 | 2A-9055251 |
| 4-Pent-1-enylbenzoic acid | 202798-06-9 | 2A-9055254 |
| 4-Bromo-4'-(diphenylamino)biphenyl | 202831-65-0 | 2A-9055255 |
| 1-Cyclopropyl-1,3-dihydro-2H-benzimidazol-2-one | 202859-73-2 | 2A-9055256 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA