
CAS Number202865-61-0
Synonyms2-Bromo-1,3-difluoro-5-methoxybenzene; 4-Bromo-3,5-difluorophenyl methyl ether; 4-BroMo-3,5-difluoroanisole; 2-Bromo-1,3-difluoro-5-methoxybenzene,4-Bromo-3,5-difluorophenyl methyl ether; 5-difluoroanisole; 4-BROMO-3,5-DIFLUOROANISOLE: TECH.; MFCD00143268; 4-BroMo-3
Molecular FormulaC7H5O1Br1F2
Molecular Weight223.02
Purity98.00%
Density1.6±0.1 g/cm3
Boiling Point176.5±35.0 °C at 760 mmHg
Melting Point26-30°C
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 202865-61-0 |
| Catalog No. | 2A-9055260 |
| Chinese Name | 4-溴-3,5-二氟苯甲醚 |
| Synonyms | 2-Bromo-1,3-difluoro-5-methoxybenzene; 4-Bromo-3,5-difluorophenyl methyl ether; 4-BroMo-3,5-difluoroanisole; 2-Bromo-1,3-difluoro-5-methoxybenzene,4-Bromo-3,5-difluorophenyl methyl ether; 5-difluoroanisole; 4-BROMO-3,5-DIFLUOROANISOLE: TECH.; MFCD00143268; 4-BroMo-3 |
| Molecular Formula | C7H5O1Br1F2 |
| Molecular Weight | 223.02 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 176.5±35.0 °C at 760 mmHg |
| Melting Point | 26-30°C |
| Appearance | liquid |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2909309090 |
| MDL Number | MFCD00143268 |
| SMILES | COc1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C7H5BrF2O/c1-11-4-2-5(9)7(8)6(10)3-4/h2-3H,1H3 |
| InChI Key | GEJMNTXYFBBTFH-UHFFFAOYSA-N |
| MSDS | msds/55260_1_202865_61_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-5-fluorobenzylamine | 202522-23-4 | 2A-9055251 |
| 4-Pent-1-enylbenzoic acid | 202798-06-9 | 2A-9055254 |
| 4-Bromo-4'-(diphenylamino)biphenyl | 202831-65-0 | 2A-9055255 |
| 1-Cyclopropyl-1,3-dihydro-2H-benzimidazol-2-one | 202859-73-2 | 2A-9055256 |
| 2-Bromo-4,5-difluoroanisole | 202865-58-5 | 2A-9055257 |
| 2-Bromo-5-fluorobenzyl alcohol | 202865-66-5 | 2A-9055261 |
| 1-Chloro-4-fluoro-2-iodobenzene | 202982-68-1 | 2A-9055271 |
| 3-Chloro-5-fluorophenol | 202982-70-5 | 2A-9055272 |
| 1,2-Diiodo-4-fluorobenzene | 203059-85-2 | 2A-9055274 |
| Laninamivir | 203120-17-6 | 2A-9055275 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA