
CAS Number83409-32-9
SynonymsN-Desethylamiodarone; Desethylamiodarone; N-Deethylamiodarone; Methanone,(2-butyl-3-benzofuranyl)(4-(2-(ethylamino)ethoxy)-3,5-diiodophenyl); N-Monodesethylamiodarone; (2-butyl-1-benzofuran-3-yl){4-[2-(ethylamino)ethoxy]-3,5-diiodophenyl}methanone; (2-Butyl-3-benzofuranyl)(4-(2-(ethylamino)ethoxy)-3,5-diiodophenyl)methanone; Deethylamiodarone
Molecular FormulaC23H25I2NO3
Molecular Weight653.72
Purity98.00%
Density1.638 g/cm3
Boiling Point630.3ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83409-32-9 |
| Catalog No. | 2A-9048882 |
| Chinese Name | 去乙基胺碘酮 |
| Synonyms | N-Desethylamiodarone; Desethylamiodarone; N-Deethylamiodarone; Methanone,(2-butyl-3-benzofuranyl)(4-(2-(ethylamino)ethoxy)-3,5-diiodophenyl); N-Monodesethylamiodarone; (2-butyl-1-benzofuran-3-yl){4-[2-(ethylamino)ethoxy]-3,5-diiodophenyl}methanone; (2-Butyl-3-benzofuranyl)(4-(2-(ethylamino)ethoxy)-3,5-diiodophenyl)methanone; Deethylamiodarone |
| Molecular Formula | C23H25I2NO3 |
| Molecular Weight | 653.72 |
| Purity | 98.00 |
| Density | 1.638 g/cm3 |
| Boiling Point | 630.3ºC at 760 mmHg |
| Application | Desethylamiodarone (N-Deethylamiodarone) is the major metabolite of the antiarrhythmic compound amiodarone (HY-14187). Desethylamiodarone has antiarrhythmic activity. Desethylamiodarone can also induc |
| PubChem ID | 10233602 |
| MDL Number | MFCD08060094 |
| SMILES | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCNCC)c(I)c1 |
| InChI | InChI=1S/C23H25I2NO3/c1-3-5-9-20-21(16-8-6-7-10-19(16)29-20)22(27)15-13-17(24)23(18(25)14-15)28-12-11-26-4-2/h6-8,10,13-14,26H,3-5,9,11-12H2,1-2H3 |
| InChI Key | VXOKDLACQICQFA-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 12352200 |
| MSDS | msds/48882_1_83409_32_9.pdf |
| Transport Info | Product Name: Desethylamiodarone |
| Related Products in API & Advanced Intermediates | ||
|---|---|---|
| Roxithromycin | 80214-83-1 | 2A-9048458 |
| Dihydroartemisinin | 81496-82-4 | 2A-9048630 |
| Atomoxetine hydrochloride | 82248-59-7 | 2A-9048718 |
| Moexipril hydrochloride | 82586-52-5 | 2A-9048771 |
| Zolpidem | 82626-48-0 | 2A-9048781 |
| Hydrocortisone hemisuccinate hydrate | 83784-20-7 | 2A-9048931 |
| Domperidone maleate | 83898-65-1 | 2A-9048955 |
| Captopril-D7 | 83993-06-0 | 2A-9048968 |
| 21-Amino-17-hydroxyprogesterone hydrochloride | 84869-30-7 | 2A-9049126 |
| O-Desmethyldiltiazem | 84903-78-6 | 2A-9049132 |
| Browse all API & Advanced Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA