
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 73150-67-1 |
| Catalog No. | 2A-9047554 |
| Chinese Name | 2-(2-氨基噻唑-4-基)乙醛酸 |
| Synonyms | atga; EINECS 277-301-0; MFCD00274532 |
| Molecular Formula | C5H4N2O3S |
| Molecular Weight | 172.16 |
| Purity | 98.00 |
| Density | 1.711 g/cm3 |
| Boiling Point | 395.7ºC at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| HTC | 2934100090 |
| PubChem ID | 38462533 |
| SMILES | Nc1nc(C(=O)C(=O)O)cs1 |
| InChI | InChI=1S/C5H4N2O3S/c6-5-7-2(1-11-5)3(8)4(9)10/h1H,(H2,6,7)(H,9,10) |
| InChI Key | VMASTYPGLHRVNL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Atractylenolide-1 | 73069-13-3 | 2A-9047540 |
| 2-Atractylenolide | 73069-14-4 | 2A-9047541 |
| Praeruptorin A | 73069-25-7 | 2A-9047542 |
| Praeruptorin A | 73069-27-9 | 2A-9047543 |
| Dicyclopropylamine | 73121-95-6 | 2A-9047552 |
| 1-(3-Chlorophenyl)-1,2-propanedione | 10557-17-2 | 2A-9047555 |
| 4-(4-Oxocyclohexyl)benzonitrile | 73204-07-6 | 2A-9047558 |
| 4-Benzoylphenyl methyl sulfoxide | 73241-57-3 | 2A-9047564 |
| Deoxynojirimycin hydrochloride | 73285-50-4 | 2A-0201313 |
| 2-Hydroxy-6-methylbenzonitrile | 73289-66-4 | 2A-9047575 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA