
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10557-17-2 |
| Catalog No. | 2A-9047555 |
| Chinese Name | 安非他酮杂质E |
| Synonyms | 1,2-Propanedione,1-(3-chlorophenyl); 1-(3-chlorophenyl)-1,2-propanedione |
| Molecular Formula | C9H7ClO2 |
| Molecular Weight | 182.60 |
| Purity | 98.00 |
| Appearance | solid |
| HTC | 2914700090 |
| PubChem ID | 329818381 |
| MDL Number | MFCD18379289 |
| SMILES | ClC1=CC=CC(C(C(C)=O)=O)=C1 |
| InChI | 1S/C9H7ClO2/c1-6(11)9(12)7-3-2-4-8(10)5-7/h2-5H,1H3 |
| InChI Key | OXRBHYVHVKOEQX-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/47555_1_10557_17_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Atractylenolide | 73069-14-4 | 2A-9047541 |
| Praeruptorin A | 73069-25-7 | 2A-9047542 |
| Praeruptorin A | 73069-27-9 | 2A-9047543 |
| Dicyclopropylamine | 73121-95-6 | 2A-9047552 |
| 2-(2-Aminothiazol-4-yl)glyoxylic acid | 73150-67-1 | 2A-9047554 |
| 4-(4-Oxocyclohexyl)benzonitrile | 73204-07-6 | 2A-9047558 |
| 4-Benzoylphenyl methyl sulfoxide | 73241-57-3 | 2A-9047564 |
| Deoxynojirimycin hydrochloride | 73285-50-4 | 2A-0201313 |
| 2-Hydroxy-6-methylbenzonitrile | 73289-66-4 | 2A-9047575 |
| Piperazin-1-ylpyrrolidin-1-ylmethanone | 73331-93-8 | 2A-9047579 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA