
CAS Number73069-13-3
Synonyms(4aS,8aS)-3,8a-Dimethyl-5-methylene-4a,5,6,7,8,8a-hexahydronaphtho[2,3-b]furan-2(4H)-one; Atractylenolide-1
Molecular FormulaC15H18O2
Molecular Weight230.30
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point405.0±44.0 °C at 760 mmHg
Melting Point121-123 °C
Appearancewhite needle crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 73069-13-3 |
| Catalog No. | 2A-9047540 |
| Chinese Name | 白术内酯I; 苍术内酯I |
| Synonyms | (4aS,8aS)-3,8a-Dimethyl-5-methylene-4a,5,6,7,8,8a-hexahydronaphtho[2,3-b]furan-2(4H)-one; Atractylenolide-1 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.30 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 405.0±44.0 °C at 760 mmHg |
| Melting Point | 121-123 °C |
| Appearance | white needle crystal |
| Water Solubility | methanol: soluble1mg/mL, clear, colorless |
| Storage Condition | 2-8°C |
| Application | Atractylenolide I is a sesquiterpene obtained from Atractylodes rhizome root and has various biological activities such as neuroprotection, anti-allergy, anti-inflammatory and anti-cancer. Atractyleno |
| PubChem ID | 15341681 |
| SMILES | C=C1CCCC2(C)C=C3OC(=O)C(C)=C3CC12 |
| InChI | InChI=1S/C15H18O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h8,12H,1,4-7H2,2-3H3/t12-,15+/m0/s1 |
| InChI Key | ZTVSGQPHMUYCRS-SWLSCSKDSA-N |
| Transport Info | Product name: Atractylodes lactone I |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,6-Dichloronicotinic acid | 73027-79-9 | 2A-9047530 |
| Atractylenolide III | 73030-71-4 | 2A-9047531 |
| 5-(4-Bromophenyl)thiazol-2-amine | 73040-60-5 | 2A-9047533 |
| 5-(2-Chlorophenyl)thiazol-2-amine | 73040-63-8 | 2A-9047534 |
| 5-(4-Chlorophenyl)-2-thiazolamine | 73040-66-1 | 2A-9047535 |
| 2-Atractylenolide | 73069-14-4 | 2A-9047541 |
| Praeruptorin A | 73069-25-7 | 2A-9047542 |
| Praeruptorin A | 73069-27-9 | 2A-9047543 |
| Dicyclopropylamine | 73121-95-6 | 2A-9047552 |
| 2-(2-Aminothiazol-4-yl)glyoxylic acid | 73150-67-1 | 2A-9047554 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA