
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54623-25-5 |
| Catalog No. | 2A-9044241 |
| Chinese Name | 2,3,5-三苄氧基-D-核糖 |
| Synonyms | D-Ribose,2,3,5-tris-O-(phenylmethyl); 2,3,5-tri-O-benzyl-D-ribose |
| Molecular Formula | C26H28O5 |
| Molecular Weight | 420.51 |
| Purity | 98.00 |
| Density | 1.175g/cm3 |
| Boiling Point | 591.5ºC at 760 mmHg |
| Water Solubility | Sparingly soluble in water.(0.26 g/L) (25°C), |
| Storage Condition | -20℃, inert gas storage |
| HTC | 2912499000 |
| PubChem ID | 129741160 |
| MDL Number | MFCD18070912 |
| SMILES | O=CC(OCc1ccccc1)C(OCc1ccccc1)C(O)COCc1ccccc1 |
| InChI | InChI=1S/C26H28O5/c27-16-25(30-18-22-12-6-2-7-13-22)26(31-19-23-14-8-3-9-15-23)24(28)20-29-17-21-10-4-1-5-11-21/h1-16,24-26,28H,17-20H2/t24-,25+,26-/m1/s1 |
| InChI Key | XUCNSIRQCBFBHF-UODIDJSMSA-N |
| MSDS | msds/44241_1_54623_25_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Propiverine hydrochloride | 54556-98-8 | 2A-9044226 |
| Doxercalciferol | 54573-75-0 | 2A-9044229 |
| 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid | 54574-82-2 | 2A-9044230 |
| D-Allylglycine | 54594-06-8 | 2A-9044233 |
| 2-Ethoxythiophenol | 54615-63-3 | 2A-9044238 |
| 2-(4-Fluorophenoxy)nicotinic acid | 54629-13-9 | 2A-9044243 |
| N-(4-Chloro-3-((4,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-1H-pyrazol-3-yl)amino)phenyl)myristamide | 54636-84-9 | 2A-9044247 |
| Poly(1,4-butanediol) bis(4-aminobenzoate) | 54667-43-5 | 2A-9044252 |
| 2-(Acetylamino)propanedioic acid 1-ethyl ester | 54681-67-3 | 2A-9044255 |
| Bis(p-methylbenzylidene)sorbitol | 54686-97-4 | 2A-9044256 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA