![2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid structure, CAS 54574-82-2](/structures/60000/44230_1_54574_82_2.png)
CAS Number54574-82-2
SynonymsMFCD00134670; 2-{[4-(dibutylamino)-2-hydroxyphenyl]carbonyl}benzoic acid; 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid; EINECS 410-410-5
Molecular Formula[CH3(CH2)3]2NC6H3(OH)COC6H4CO2H
Molecular Weight369.45
Purity99%
Density1.2±0.1 g/cm3
Boiling Point570.2±45.0 °C at 760 mmHg
Melting Point190-193 °C (lit.)
Appearancesolid
EINECS410-410-5
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54574-82-2 |
| Catalog No. | 2A-9044230 |
| Chinese Name | 4-二丁基酮酸(BBA) |
| Synonyms | MFCD00134670; 2-{[4-(dibutylamino)-2-hydroxyphenyl]carbonyl}benzoic acid; 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid; EINECS 410-410-5 |
| Molecular Formula | [CH3(CH2)3]2NC6H3(OH)COC6H4CO2H |
| Molecular Weight | 369.45 |
| Purity | 99 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 570.2±45.0 °C at 760 mmHg |
| Melting Point | 190-193 °C (lit.) |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| EINECS | 410-410-5 |
| HTC | 2922509090 |
| PubChem ID | 24865083 |
| MDL Number | MFCD00134670 |
| SMILES | CCCCN(CCCC)c1ccc(c(O)c1)C(=O)c2ccccc2C(O)=O |
| InChI | 1S/C22H27NO4/c1-3-5-13-23(14-6-4-2)16-11-12-19(20(24)15-16)21(25)17-9-7-8-10-18(17)22(26)27/h7-12,15,24H,3-6,13-14H2,1-2H3,(H,26,27) |
| InChI Key | QPNFUBAIQZJEPO-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/44230_1_54574_82_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2-Ethoxyethoxy)ethyl bromide | 54550-36-6 | 2A-9044223 |
| 2-Phenyl-2-imidazoline pyromellitate | 54553-90-1 | 2A-9044224 |
| Pyromellitic acid di(2-phenyl-2-imidazoline) salt | 54553-91-2 | 2A-9044225 |
| Propiverine hydrochloride | 54556-98-8 | 2A-9044226 |
| Doxercalciferol | 54573-75-0 | 2A-9044229 |
| D-Allylglycine | 54594-06-8 | 2A-9044233 |
| 2-Ethoxythiophenol | 54615-63-3 | 2A-9044238 |
| 2,3,5-Tri-O-benzyl-D-ribose | 54623-25-5 | 2A-9044241 |
| 2-(4-Fluorophenoxy)nicotinic acid | 54629-13-9 | 2A-9044243 |
| N-(4-Chloro-3-((4,5-dihydro-5-oxo-1-(2,4,6-trichlorophenyl)-1H-pyrazol-3-yl)amino)phenyl)myristamide | 54636-84-9 | 2A-9044247 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA