
CAS Number54523-47-6
Synonyms4,4'-Dibromodibenzyl ketone; 1,3-Bis-(4-bromophenyl)propan-1-one; 1,3-Bis(4-bromophenyl)-1-propanone
Molecular FormulaC15H12Br2O
Molecular Weight368.07
Purity98.00%
Density1.6±0.1 g/cm3
Boiling Point449.6±35.0 °C at 760 mmHg
Melting Point119°C
AppearanceWhite-light yellow crystal-powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54523-47-6 |
| Catalog No. | 2A-9044219 |
| Chinese Name | 1,3-双(4-溴苯基)-2-丙酮 |
| Synonyms | 4,4'-Dibromodibenzyl ketone; 1,3-Bis-(4-bromophenyl)propan-1-one; 1,3-Bis(4-bromophenyl)-1-propanone |
| Molecular Formula | C15H12Br2O |
| Molecular Weight | 368.07 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 449.6±35.0 °C at 760 mmHg |
| Melting Point | 119°C |
| Appearance | White-light yellow crystal-powder |
| Storage Condition | room temperature, dry |
| HTC | 2914700090 |
| PubChem ID | 8694624 |
| InChI | InChI=1S/C15H12Br2O/c16-13-6-1-11(2-7-13)3-10-15(18)12-4-8-14(17)9-5-12/h1-2,4-9H,3,10H2 |
| InChI Key | PQDQAUVBWSUMMB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-(4-Bromophenyl)-4H-1,2,4-triazol-3-amine | 54464-13-0 | 2A-9044210 |
| 5-(4-Methoxyphenyl)-4H-1,2,4-triazol-3-amine | 54464-14-1 | 2A-9044211 |
| 1-(2,3,8,8-Tetramethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)ethanone | 54464-57-2 | 2A-9044212 |
| Cyclohexanone-3,3,4,4,5,5-D6 | 54513-99-4 | 2A-9044217 |
| Methylprotodioscin | 54522-52-0 | 2A-9044218 |
| Nizofenone | 54533-85-6 | 2A-9044222 |
| 2-(2-Ethoxyethoxy)ethyl bromide | 54550-36-6 | 2A-9044223 |
| 2-Phenyl-2-imidazoline pyromellitate | 54553-90-1 | 2A-9044224 |
| Pyromellitic acid di(2-phenyl-2-imidazoline) salt | 54553-91-2 | 2A-9044225 |
| Propiverine hydrochloride | 54556-98-8 | 2A-9044226 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA