
CAS Number54464-57-2
Synonyms1-(2,3,8,8-Tetramethyl-1,2,3,4,5,6,7,8-octahydro-2-naphthalenyl)ethanone; L66 AU- FTJ B1 B1 H1 IV1 I1; Boisvelone; 7-acetyl-1,2,3,4,5,6,7,8-octahydro-1,1,6,7-tetramethylnaphthalene; 1-(2,3,8,8-Tetramethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)ethan-1-one; 1-(1,2,3,4,5,6,7,8-Octahydro-2,3,8,8-tetramethyl-2-naphthalenyl)ethanone; Isocyclemone E; Iso E super; UNII-1GD7ODM28Y
Molecular FormulaC16H26O
Molecular Weight234.38
Purity≥90%
Density1.0±0.1 g/cm3
Boiling Point312.2±31.0 °C at 760 mmHg
AppearanceTransparent colorless to slightly light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54464-57-2 |
| Catalog No. | 2A-9044212 |
| Chinese Name | 龙涎酮 |
| Synonyms | 1-(2,3,8,8-Tetramethyl-1,2,3,4,5,6,7,8-octahydro-2-naphthalenyl)ethanone; L66 AU- FTJ B1 B1 H1 IV1 I1; Boisvelone; 7-acetyl-1,2,3,4,5,6,7,8-octahydro-1,1,6,7-tetramethylnaphthalene; 1-(2,3,8,8-Tetramethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)ethan-1-one; 1-(1,2,3,4,5,6,7,8-Octahydro-2,3,8,8-tetramethyl-2-naphthalenyl)ethanone; Isocyclemone E; Iso E super; UNII-1GD7ODM28Y |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 |
| Purity | ≥90 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 312.2±31.0 °C at 760 mmHg |
| Appearance | Transparent colorless to slightly light yellow liquid |
| Storage Condition | Refrigerator |
| HTC | 2914299000 |
| PubChem ID | 6783149 |
| MDL Number | MFCD00217013 |
| SMILES | O=C(C1(C(CC2=C(C(CCC2)(C)C)C1)C)C)C |
| InChI | 1S/C16H26O/c1-11-9-13-7-6-8-15(3,4)14(13)10-16(11,5)12(2)17/h11H,6-10H2,1-5H3 |
| InChI Key | FVUGZKDGWGKCFE-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1961701 |
| NACRES Code | NA.21 |
| UNSPSC | 12164502 |
| MSDS | msds/44212_1_54464_57_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2914299000. other cyclanic, cyclenic or cyclootherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromodiphenylamine | 54446-36-5 | 2A-9044205 |
| Ethyl 2-chloroisonicotinate | 54453-93-9 | 2A-9044207 |
| 2,3,4,5-Tetramethyl-2-cyclopentenone | 54458-61-6 | 2A-9044209 |
| 5-(4-Bromophenyl)-4H-1,2,4-triazol-3-amine | 54464-13-0 | 2A-9044210 |
| 5-(4-Methoxyphenyl)-4H-1,2,4-triazol-3-amine | 54464-14-1 | 2A-9044211 |
| Cyclohexanone-3,3,4,4,5,5-D6 | 54513-99-4 | 2A-9044217 |
| Methylprotodioscin | 54522-52-0 | 2A-9044218 |
| 1,3-Bis(4-bromophenyl)propanone | 54523-47-6 | 2A-9044219 |
| Nizofenone | 54533-85-6 | 2A-9044222 |
| 2-(2-Ethoxyethoxy)ethyl bromide | 54550-36-6 | 2A-9044223 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA