CAS Number94087-40-8
Synonymschloro fluorobenzonitrile; 2-fluoro-3-chlorobenzonitrile; EINECS 301-934-4; MFCD00042206; Benzonitrile,3-chloro-2-fluoro; 3-Chloro-2-fluorobenzonitrile; NCR CG BF
Molecular FormulaC7H3ClFN
Molecular Weight155.557
Purity98%
Density1.3±0.1 g/cm3
Boiling Point206.3±20.0 °C at 760 mmHg
Melting Point40-44ºC
AppearanceWhite to yellow powder, crystals, crystalline powder, solids and/or chunks
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 94087-40-8 |
| Catalog No. | 2A-9004310 |
| Chinese Name | 3-氯-2-氟苯甲腈 |
| Synonyms | chloro fluorobenzonitrile; 2-fluoro-3-chlorobenzonitrile; EINECS 301-934-4; MFCD00042206; Benzonitrile,3-chloro-2-fluoro; 3-Chloro-2-fluorobenzonitrile; NCR CG BF |
| Molecular Formula | C7H3ClFN |
| Molecular Weight | 155.557 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 206.3±20.0 °C at 760 mmHg |
| Melting Point | 40-44ºC |
| Appearance | White to yellow powder, crystals, crystalline powder, solids and/or chunks |
| Storage Condition | Room Temperature |
| Packaging | III |
| HTC | 2926909090 |
| SMILES | N#Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C7H3ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H |
| InChI Key | CHKLNKWJIDQKFV-UHFFFAOYSA-N |
| MSDS | msds/4310_2_94087_40_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Item 1 Poisons. UN number: 3439 Proper shipping name: Nitrile, Solid, Toxic, Not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3'-Chloro-2',6'-difluoroacetophenone | 177942-50-6 | 2A-9004297 |
| 3-Chloro-2,6-difluorobenzoic acid | 225104-76-7 | 2A-9004299 |
| 3-Chloro-2,6-difluorobenzyl bromide | 261762-47-4 | 2A-9004300 |
| 3-Chloro-2-fluoroaniline | 2106-04-9 | 2A-9004307 |
| 3-Chloro-2-fluorobenzenesulphonyl chloride | 351003-48-0 | 2A-9004309 |
| 3-Chloro-2-fluorobenzoyl chloride | 85345-76-2 | 2A-9004311 |
| 3-Chloro-2-fluorobenzyl bromide | 85070-47-9 | 2A-9004312 |
| 3-Chloro-2-fluorobenzylamine | 72235-55-3 | 2A-9004313 |
| 3-Chloro-2-fluoroiodobenzene | 72373-82-1 | 2A-9004314 |
| 3-Chloro-2-fluoronitrobenzene | 2106-49-2 | 2A-9004315 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS