
CAS Number225104-76-7
Synonyms2,6-difluouo-3-chlorobenzoic acid; 2,6-Difluoro-3-chlorobenzoic acid; QVR CG BF FF; 3-Chloro-2,6-difluoro-Benzoicacid; MFCD01631322; 3-Chloro-2,6-difluorobenzoic acid
Molecular FormulaC7H3ClF2O2
Molecular Weight192.547
Purity97%
Density1.6±0.1 g/cm3
Boiling Point264.5±35.0 °C at 760 mmHg
Melting Point126-128°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 225104-76-7 |
| Catalog No. | 2A-9004299 |
| Chinese Name | 3-氯-2,6-二氟苯甲酸 |
| Synonyms | 2,6-difluouo-3-chlorobenzoic acid; 2,6-Difluoro-3-chlorobenzoic acid; QVR CG BF FF; 3-Chloro-2,6-difluoro-Benzoicacid; MFCD01631322; 3-Chloro-2,6-difluorobenzoic acid |
| Molecular Formula | C7H3ClF2O2 |
| Molecular Weight | 192.547 |
| Purity | 97 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 264.5±35.0 °C at 760 mmHg |
| Melting Point | 126-128°C |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2916399090 |
| SMILES | O=C(O)c1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C7H3ClF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2H,(H,11,12) |
| InChI Key | APQTVWJSXBBNEI-UHFFFAOYSA-N |
| MSDS | msds/4299_1_225104_76_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-1,2-dibromopropane | 96-12-8 | 2A-9004287 |
| 3-Chloro-2,2-dimethylpropionyl chloride | 4300-97-4 | 2A-9004289 |
| 3-Chloro-2,4,5,6- tetrafluorobenzoic acid | 5360-81-6 | 2A-9004290 |
| 3-Chloro-2,6-dibromo-4-fluoroaniline | 175135-09-8 | 2A-9004296 |
| 3'-Chloro-2',6'-difluoroacetophenone | 177942-50-6 | 2A-9004297 |
| 3-Chloro-2,6-difluorobenzyl bromide | 261762-47-4 | 2A-9004300 |
| 3-Chloro-2-fluoroaniline | 2106-04-9 | 2A-9004307 |
| 3-Chloro-2-fluorobenzenesulphonyl chloride | 351003-48-0 | 2A-9004309 |
| 3-Chloro-2-fluorobenzonitrile | 94087-40-8 | 2A-9004310 |
| 3-Chloro-2-fluorobenzoyl chloride | 85345-76-2 | 2A-9004311 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA