
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261762-47-4 |
| Catalog No. | 2A-9004300 |
| Chinese Name | 3-氯-2,6-二氟苄基溴 |
| Synonyms | 3-Chloro-2,6-difluorobenzyl bromide; JRD-1005; 2,6-difluoro-3-chlorobenzyl bromide; MFCD01631326 |
| Molecular Formula | C7H4Cl1Br1F2 |
| Molecular Weight | 241.46 |
| Purity | 97 |
| Density | 1.733g/cm3 |
| Boiling Point | 222.9ºC at 760mmHg |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| Packaging | III |
| HTC | 2903999090 |
| MDL Number | MFCD01631326 |
| SMILES | Fc1ccc(Cl)c(F)c1CBr |
| InChI | InChI=1S/C7H4BrClF2/c8-3-4-6(10)2-1-5(9)7(4)11/h1-2H,3H2 |
| InChI Key | SNOJSRMVFAKBEG-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/4300_1_261762_47_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-2,2-dimethylpropionyl chloride | 4300-97-4 | 2A-9004289 |
| 3-Chloro-2,4,5,6- tetrafluorobenzoic acid | 5360-81-6 | 2A-9004290 |
| 3-Chloro-2,6-dibromo-4-fluoroaniline | 175135-09-8 | 2A-9004296 |
| 3'-Chloro-2',6'-difluoroacetophenone | 177942-50-6 | 2A-9004297 |
| 3-Chloro-2,6-difluorobenzoic acid | 225104-76-7 | 2A-9004299 |
| 3-Chloro-2-fluoroaniline | 2106-04-9 | 2A-9004307 |
| 3-Chloro-2-fluorobenzenesulphonyl chloride | 351003-48-0 | 2A-9004309 |
| 3-Chloro-2-fluorobenzonitrile | 94087-40-8 | 2A-9004310 |
| 3-Chloro-2-fluorobenzoyl chloride | 85345-76-2 | 2A-9004311 |
| 3-Chloro-2-fluorobenzyl bromide | 85070-47-9 | 2A-9004312 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA