
CAS Number72235-55-3
SynonymsMFCD01631391; (3-Chloro-2-fluorophenyl)methanamine; 1-(3-Chloro-2-fluorophenyl)methanamine; 3-Chloro-2-fluorobenzylamine; Z1R CG BF; 1-(3-Chloro-2-fluorophenyl)methylamine; (3-Chloro-2-fluorophenyl)methylamine; 3-Chloro-2-fluorobenzenemethanamine
Molecular FormulaC7H7ClFN
Molecular Weight159.589
Purity97%
Density1.3±0.1 g/cm3
Boiling Point219.6±25.0 °C at 760 mmHg
Appearancecolorless liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72235-55-3 |
| Catalog No. | 2A-9004313 |
| Chinese Name | 3-氯-2-氟苄胺 |
| Synonyms | MFCD01631391; (3-Chloro-2-fluorophenyl)methanamine; 1-(3-Chloro-2-fluorophenyl)methanamine; 3-Chloro-2-fluorobenzylamine; Z1R CG BF; 1-(3-Chloro-2-fluorophenyl)methylamine; (3-Chloro-2-fluorophenyl)methylamine; 3-Chloro-2-fluorobenzenemethanamine |
| Molecular Formula | C7H7ClFN |
| Molecular Weight | 159.589 |
| Purity | 97 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 219.6±25.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Store in a container filled with dry inert gas and |
| Packaging | III |
| HTC | 2921499090 |
| SMILES | NCc1cccc(Cl)c1F |
| InChI | InChI=1S/C7H7ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
| InChI Key | LYKWZKBLNOCJMA-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/4313_1_72235_55_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-2-fluoroaniline | 2106-04-9 | 2A-9004307 |
| 3-Chloro-2-fluorobenzenesulphonyl chloride | 351003-48-0 | 2A-9004309 |
| 3-Chloro-2-fluorobenzonitrile | 94087-40-8 | 2A-9004310 |
| 3-Chloro-2-fluorobenzoyl chloride | 85345-76-2 | 2A-9004311 |
| 3-Chloro-2-fluorobenzyl bromide | 85070-47-9 | 2A-9004312 |
| 3-Chloro-2-fluoroiodobenzene | 72373-82-1 | 2A-9004314 |
| 3-Chloro-2-fluoronitrobenzene | 2106-49-2 | 2A-9004315 |
| 3-Chloro-2-fluorophenylhydrazine hydrochloride | 517920-75-1 | 2A-9004316 |
| 3-Chloro-2-methylbenzenesulphonyl chloride | 80563-86-6 | 2A-9004319 |
| 3-Chloro-2-nitrobenzoic acid | 4771-47-5 | 2A-9004321 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA