
CAS Number42288-46-0
SynonymsMFCD00082776; 2-(3,5-dimethylphenyl)acetic acid; 3,5-Dimethylphenylacetic Acid
Molecular FormulaC10H12O2
Molecular Weight164.2
Purity98.00%
Density1.098 g/cm3
Boiling Point291ºC at 760 mmHg
Melting Point98-102ºC
AppearanceWhite to light beige crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42288-46-0 |
| Catalog No. | 2A-9042939 |
| Chinese Name | 3,5-二甲基苯乙酸 |
| Synonyms | MFCD00082776; 2-(3,5-dimethylphenyl)acetic acid; 3,5-Dimethylphenylacetic Acid |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.2 |
| Purity | 98.00 |
| Density | 1.098 g/cm3 |
| Boiling Point | 291ºC at 760 mmHg |
| Melting Point | 98-102ºC |
| Appearance | White to light beige crystalline powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2916399090 |
| PubChem ID | 6997305 |
| SMILES | Cc1cc(C)cc(CC(=O)O)c1 |
| InChI | InChI=1S/C10H12O2/c1-7-3-8(2)5-9(4-7)6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
| InChI Key | HDNBKTWQBJJYPD-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethylmethyl-carbamic chloride | 42252-34-6 | 2A-9042932 |
| 3-(3-Bromophenyl)propionic acid | 42287-90-1 | 2A-9042935 |
| 3-(4-Cyanophenyl)propanoic acid | 42287-94-5 | 2A-9042936 |
| 3-Cyanobenzenepropanoic acid | 42287-97-8 | 2A-9042937 |
| N-(4-Cyanophenyl)glycine | 42288-26-6 | 2A-9042938 |
| 2,3,5,6-Tetrafluorophenole potassium salt | 42289-34-9 | 2A-9042940 |
| 3-Aminopropylbis(trimethylsiloxy)methylsilane | 42292-18-2 | 2A-9042941 |
| 2-(2-Amino-4-chlorophenoxy)-5-chlorobenzenesulfonic acid | 42293-27-6 | 2A-9042942 |
| 3-(Dimethylamino)-1-propanethiol | 42302-17-0 | 2A-9042944 |
| 4-Chlorobutan-1-amine | 42330-95-0 | 2A-9042948 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA