
CAS Number42252-34-6
SynonymsEthyl(methyl)carbamic chloride; N-Ethyl-N-methylcarbamoylchloride; MFCD08061404; GVN2&1; N-ethyl-N-methylcarbamoyl chloride
Molecular FormulaC4H8ClNO
Molecular Weight121.565
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point165.1±9.0 °C at 760 mmHg
AppearanceLiquid;Colorless to Almost colorless clear liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42252-34-6 |
| Catalog No. | 2A-9042932 |
| Chinese Name | N-乙基甲基氨基甲酰氯 |
| Synonyms | Ethyl(methyl)carbamic chloride; N-Ethyl-N-methylcarbamoylchloride; MFCD08061404; GVN2&1; N-ethyl-N-methylcarbamoyl chloride |
| Molecular Formula | C4H8ClNO |
| Molecular Weight | 121.565 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 165.1±9.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Refrigerator, Under Inert Atmosphere |
| Packaging | II |
| HTC | 2903199000 |
| PubChem ID | 16324535 |
| SMILES | CCN(C)C(=O)Cl |
| InChI | InChI=1S/C4H8ClNO/c1-3-6(2)4(5)7/h3H2,1-2H3 |
| InChI Key | XZVYDRLPXWFRIS-UHFFFAOYSA-N |
| Hazard Symbols | Category 8 |
| MSDS | msds/42932_1_42252_34_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3265 Proper shipping name: Corrosive Liquid, Acidic, Organic, Not Otherwise Specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(1-Oxopropyl)-L-alanine ethyl ester | 42167-52-2 | 2A-9042920 |
| Palladium(II) trifluoroacetate | 42196-31-6 | 2A-9042924 |
| Rhodium acetate | 42204-14-8 | 2A-9042925 |
| 2,3,4,5-Tetrachlorobenzoyl chloride | 42221-52-3 | 2A-9042927 |
| Bis(4-amino-2,3-dichlorophenyl)methane | 42240-73-3 | 2A-9042928 |
| 3-(3-Bromophenyl)propionic acid | 42287-90-1 | 2A-9042935 |
| 3-(4-Cyanophenyl)propanoic acid | 42287-94-5 | 2A-9042936 |
| 3-Cyanobenzenepropanoic acid | 42287-97-8 | 2A-9042937 |
| N-(4-Cyanophenyl)glycine | 42288-26-6 | 2A-9042938 |
| 3,5-Dimethylphenylacetic acid | 42288-46-0 | 2A-9042939 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA