
CAS Number42289-34-9
Synonyms2,3,5,6-Tetrafluorophenole potassium salt; Potassium 2,3,5,6-tetrafluorophenolate; potassium 2,3,5,6-tetrakis(fluoranyl)phenolate; Phenol, 2,3,5,6-tetrafluoro-, potassium salt (1:1); 2,3,4,5-TETRAHYDRO-1H-BENZO[E][1,4]DIAZEPIN-8-YLAMINE
Molecular FormulaC6HF4KO
Molecular Weight204.163
Purity98.00%
Boiling Point140.2ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42289-34-9 |
| Catalog No. | 2A-9042940 |
| Chinese Name | 2,3,5,6-四氟苯酚钾盐 |
| Synonyms | 2,3,5,6-Tetrafluorophenole potassium salt; Potassium 2,3,5,6-tetrafluorophenolate; potassium 2,3,5,6-tetrakis(fluoranyl)phenolate; Phenol, 2,3,5,6-tetrafluoro-, potassium salt (1:1); 2,3,4,5-TETRAHYDRO-1H-BENZO[E][1,4]DIAZEPIN-8-YLAMINE |
| Molecular Formula | C6HF4KO |
| Molecular Weight | 204.163 |
| Purity | 98.00 |
| Boiling Point | 140.2ºC at 760 mmHg |
| HTC | 2908199090 |
| PubChem ID | 6795664 |
| SMILES | [K+].[O-]c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C6H2F4O.K/c7-2-1-3(8)5(10)6(11)4(2)9;/h1,11H;/q;+1/p-1 |
| InChI Key | ISDZZAZYUPHOFG-UHFFFAOYSA-M |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(3-Bromophenyl)propionic acid | 42287-90-1 | 2A-9042935 |
| 3-(4-Cyanophenyl)propanoic acid | 42287-94-5 | 2A-9042936 |
| 3-Cyanobenzenepropanoic acid | 42287-97-8 | 2A-9042937 |
| N-(4-Cyanophenyl)glycine | 42288-26-6 | 2A-9042938 |
| 3,5-Dimethylphenylacetic acid | 42288-46-0 | 2A-9042939 |
| 3-Aminopropylbis(trimethylsiloxy)methylsilane | 42292-18-2 | 2A-9042941 |
| 2-(2-Amino-4-chlorophenoxy)-5-chlorobenzenesulfonic acid | 42293-27-6 | 2A-9042942 |
| 3-(Dimethylamino)-1-propanethiol | 42302-17-0 | 2A-9042944 |
| 4-Chlorobutan-1-amine | 42330-95-0 | 2A-9042948 |
| 9,10-Dihydro-9,9-dimethylanthracene | 42332-94-5 | 2A-9042949 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA