
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42293-27-6 |
| Catalog No. | 2A-9042942 |
| Chinese Name | 2-氨基-4,4'-二氯二苯醚-2'-磺酸 |
| Synonyms | 2-(2-Amino-4-chlorophenoxy)-5-chlorobenzenesulfonic acid; einecs 255-752-4 |
| Molecular Formula | C12H8Cl2NNaO4S |
| Molecular Weight | 356.162 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| HTC | 2922299090 |
| PubChem ID | 10257401 |
| MDL Number | MFCD00025213 |
| SMILES | Nc1cc(Cl)ccc1Oc1ccc(Cl)cc1S(=O)(=O)O |
| InChI | InChI=1S/C12H9Cl2NO4S/c13-7-1-3-10(9(15)5-7)19-11-4-2-8(14)6-12(11)20(16,17)18/h1-6H,15H2,(H,16,17,18) |
| InChI Key | WBHYFZRZFGQXBT-UHFFFAOYSA-N |
| MSDS | msds/42942_1_42293_27_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Cyanobenzenepropanoic acid | 42287-97-8 | 2A-9042937 |
| N-(4-Cyanophenyl)glycine | 42288-26-6 | 2A-9042938 |
| 3,5-Dimethylphenylacetic acid | 42288-46-0 | 2A-9042939 |
| 2,3,5,6-Tetrafluorophenole potassium salt | 42289-34-9 | 2A-9042940 |
| 3-Aminopropylbis(trimethylsiloxy)methylsilane | 42292-18-2 | 2A-9042941 |
| 3-(Dimethylamino)-1-propanethiol | 42302-17-0 | 2A-9042944 |
| 4-Chlorobutan-1-amine | 42330-95-0 | 2A-9042948 |
| 9,10-Dihydro-9,9-dimethylanthracene | 42332-94-5 | 2A-9042949 |
| 4-Methyl-3-ethylcyclopentane-1,2-dione | 42348-12-9 | 2A-9042950 |
| Sodiumpyrophosphateperoxide | 15039-07-3 | 2A-9042951 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA