CAS Number6325-93-5
Synonyms4-Nitrobenzolesulfamide; 4-Nitrobenzenesulphonamide; Benzenesulfonamide,p-nitro; EINECS 228-691-6; Benzenesulfonamide,4-nitro; p-Nitrophenylsulfonamide; 4-Nitro-benzenesulfonamide; MFCD00007937; p-Nitrobenzene sulphonamide; 4-nitrophenylsulfonamide; p-Nitrobenzenesulfonamide; p-nosyl-NH2
Molecular FormulaO2NC6H4SO2NH2
Molecular Weight202.19
Purity97%
Density1.552 g/cm3
Boiling Point417.8ºC at 760 mmHg
Melting Point178-180 °C (lit.)
AppearanceLight yellow to beige crystalline powder
EINECS228-691-6
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6325-93-5 |
| Catalog No. | 2A-9032755 |
| Chinese Name | 4-硝基苯磺酰胺 |
| Synonyms | 4-Nitrobenzolesulfamide; 4-Nitrobenzenesulphonamide; Benzenesulfonamide,p-nitro; EINECS 228-691-6; Benzenesulfonamide,4-nitro; p-Nitrophenylsulfonamide; 4-Nitro-benzenesulfonamide; MFCD00007937; p-Nitrobenzene sulphonamide; 4-nitrophenylsulfonamide; p-Nitrobenzenesulfonamide; p-nosyl-NH2 |
| Molecular Formula | O2NC6H4SO2NH2 |
| Molecular Weight | 202.19 |
| Purity | 97 |
| Density | 1.552 g/cm3 |
| Boiling Point | 417.8ºC at 760 mmHg |
| Melting Point | 178-180 °C (lit.) |
| Appearance | Light yellow to beige crystalline powder |
| Storage Condition | Seal in container and store in a cool, dry place |
| EINECS | 228-691-6 |
| HTC | 2935009090 |
| PubChem ID | 24847420 |
| MDL Number | MFCD00007937 |
| SMILES | NS(=O)(=O)c1ccc(cc1)[N+]([O-])=O |
| InChI | 1S/C6H6N2O4S/c7-13(11,12)6-3-1-5(2-4-6)8(9)10/h1-4H,(H2,7,11,12) |
| InChI Key | QWKKYJLAUWFPDB-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/32755_1_6325_93_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 35.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-nitrobenzenesulfonamide Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (4-Chlorophenyl)(2-pyridinyl)methanone | 6318-51-0 | 2A-9032739 |
| 5-Aminobenzene-1,3-diol hydrochloride | 6318-56-5 | 2A-9032740 |
| 4-Bromo-3-nitrobenzoic acid | 6319-40-0 | 2A-9032741 |
| 3-(Morpholin-4-yl)propionic acid hydrochloride | 6319-95-5 | 2A-9032742 |
| 2,4,6-Trichloroiodobenzene | 6324-50-1 | 2A-9032753 |
| 4-Methylbenzene-1-carboximidamide hydrochloride | 6326-27-8 | 2A-9032756 |
| 6-Bromoisatin | 6326-79-0 | 2A-9032757 |
| 3-(Benzyloxy)propionitrile | 6328-48-9 | 2A-9032758 |
| 6-Methyl-2-(methylthio)pyrimidin-4-ol | 6328-58-1 | 2A-9032759 |
| Ethyl 2-chloroethylcarbamate | 6329-26-6 | 2A-9032760 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS