
CAS Number6324-50-1
Synonyms2,4,6-trichloroidobenzene; 1,3,5-Trichloro-2-iodobenzene; 2,4,6-Trichloro-1-iodobenzene; 2-Iodo-1,3,5-trichlorobenzene; 1-IODO-2,4,6-TRICHLOROBENZENE; MFCD00052857; BUTTPARK 50 7-79; Benzene,1,3,5-trichloro-2-iodo; 1,3,5-Trichlor-2-jod-benzol
Molecular FormulaC6H2Cl3I
Molecular Weight307.344
Purity98.00%
Density2.1±0.1 g/cm3
Boiling Point297.5±35.0 °C at 760 mmHg
Melting Point56ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6324-50-1 |
| Catalog No. | 2A-9032753 |
| Chinese Name | 1-碘-2,4,6-三氯苯 |
| Synonyms | 2,4,6-trichloroidobenzene; 1,3,5-Trichloro-2-iodobenzene; 2,4,6-Trichloro-1-iodobenzene; 2-Iodo-1,3,5-trichlorobenzene; 1-IODO-2,4,6-TRICHLOROBENZENE; MFCD00052857; BUTTPARK 50 7-79; Benzene,1,3,5-trichloro-2-iodo; 1,3,5-Trichlor-2-jod-benzol |
| Molecular Formula | C6H2Cl3I |
| Molecular Weight | 307.344 |
| Purity | 98.00 |
| Density | 2.1±0.1 g/cm3 |
| Boiling Point | 297.5±35.0 °C at 760 mmHg |
| Melting Point | 56ºC |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2903999090 |
| SMILES | Clc1cc(Cl)c(I)c(Cl)c1 |
| InChI | InChI=1S/C6H2Cl3I/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
| InChI Key | XXFFSBRDPQFIPO-UHFFFAOYSA-N |
| MSDS | msds/32753_1_6324_50_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(Phenylthio)benzyl alcohol | 6317-56-2 | 2A-9032738 |
| (4-Chlorophenyl)(2-pyridinyl)methanone | 6318-51-0 | 2A-9032739 |
| 5-Aminobenzene-1,3-diol hydrochloride | 6318-56-5 | 2A-9032740 |
| 4-Bromo-3-nitrobenzoic acid | 6319-40-0 | 2A-9032741 |
| 3-(Morpholin-4-yl)propionic acid hydrochloride | 6319-95-5 | 2A-9032742 |
| 4-Nitrobenzenesulfonamide | 6325-93-5 | 2A-9032755 |
| 4-Methylbenzene-1-carboximidamide hydrochloride | 6326-27-8 | 2A-9032756 |
| 6-Bromoisatin | 6326-79-0 | 2A-9032757 |
| 3-(Benzyloxy)propionitrile | 6328-48-9 | 2A-9032758 |
| 6-Methyl-2-(methylthio)pyrimidin-4-ol | 6328-58-1 | 2A-9032759 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA