
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6318-51-0 |
| Catalog No. | 2A-9032739 |
| Chinese Name | (4-氯苯基)(2-吡啶基)甲酮 |
| Synonyms | (4-chlorophenyl)-pyridin-2-ylmethanone |
| Molecular Formula | C12H8ClNO |
| Molecular Weight | 217.657 |
| Purity | 98.00 |
| Density | 1.26 g/cm3 |
| Boiling Point | 356ºC at 760 mmHg |
| Melting Point | 62.0 to 66.0 deg-C |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2933399090 |
| MDL Number | MFCD02930888 |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C12H8ClNO/c13-10-6-4-9(5-7-10)12(15)11-3-1-2-8-14-11/h1-8H |
| InChI Key | KHXSJSBQIWAIEG-UHFFFAOYSA-N |
| MSDS | msds/32739_1_6318_51_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-3-bromobenzoic acid | 6311-37-1 | 2A-9032727 |
| 2,5-Dimethoxy-4-nitroaniline | 6313-37-7 | 2A-9032731 |
| 4-Aminoveratrole | 6315-89-5 | 2A-9032735 |
| Methylenedithiocyanate | 6317-18-6 | 2A-9032736 |
| 4-(Phenylthio)benzyl alcohol | 6317-56-2 | 2A-9032738 |
| 5-Aminobenzene-1,3-diol hydrochloride | 6318-56-5 | 2A-9032740 |
| 4-Bromo-3-nitrobenzoic acid | 6319-40-0 | 2A-9032741 |
| 3-(Morpholin-4-yl)propionic acid hydrochloride | 6319-95-5 | 2A-9032742 |
| 2,4,6-Trichloroiodobenzene | 6324-50-1 | 2A-9032753 |
| 4-Nitrobenzenesulfonamide | 6325-93-5 | 2A-9032755 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA