
CAS Number6318-56-5
Synonyms5-Amino-1,3-benzenediol hydrochloride (1:1); 1,3-Benzenediol, 5-amino-, hydrochloride (1:1); 5-aminobenzene-1,3-diol,hydrochloride; 5-Aminobenzene-1,3-diol hydrochloride (1:1); 5-Aminoresorcinol, hydrochloride
Molecular FormulaC6H8O2N1Cl1
Molecular Weight161.59
Purity98.00%
Melting Point182ºC
Appearancegray to black solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6318-56-5 |
| Catalog No. | 2A-9032740 |
| Chinese Name | 5-氨基苯-1,3-二醇盐酸盐 |
| Synonyms | 5-Amino-1,3-benzenediol hydrochloride (1:1); 1,3-Benzenediol, 5-amino-, hydrochloride (1:1); 5-aminobenzene-1,3-diol,hydrochloride; 5-Aminobenzene-1,3-diol hydrochloride (1:1); 5-Aminoresorcinol, hydrochloride |
| Molecular Formula | C6H8O2N1Cl1 |
| Molecular Weight | 161.59 |
| Purity | 98.00 |
| Melting Point | 182ºC |
| Appearance | gray to black solid |
| Storage Condition | 2~8°C |
| HTC | 2922299090 |
| MDL Number | MFCD00662897 |
| SMILES | Cl.Nc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C6H7NO2.Cl/c7-4-1-5(8)3-6(9)2-4;/h1-3,8-9H,7H2; |
| InChI Key | VNZZCDQPCQIUGG-UHFFFAOYSA-N |
| MSDS | msds/32740_1_6318_56_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Dimethoxy-4-nitroaniline | 6313-37-7 | 2A-9032731 |
| 4-Aminoveratrole | 6315-89-5 | 2A-9032735 |
| Methylenedithiocyanate | 6317-18-6 | 2A-9032736 |
| 4-(Phenylthio)benzyl alcohol | 6317-56-2 | 2A-9032738 |
| (4-Chlorophenyl)(2-pyridinyl)methanone | 6318-51-0 | 2A-9032739 |
| 4-Bromo-3-nitrobenzoic acid | 6319-40-0 | 2A-9032741 |
| 3-(Morpholin-4-yl)propionic acid hydrochloride | 6319-95-5 | 2A-9032742 |
| 2,4,6-Trichloroiodobenzene | 6324-50-1 | 2A-9032753 |
| 4-Nitrobenzenesulfonamide | 6325-93-5 | 2A-9032755 |
| 4-Methylbenzene-1-carboximidamide hydrochloride | 6326-27-8 | 2A-9032756 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA