
CAS Number491-60-1
Synonyms1,3,8-Trihydroxy-6-methyl-anthron; 6-methyl-1,3,8-trihydroxy-10H-anthracene-9-one; Emodinanthrone; 1,3,8-trihydroxy-6-methyl-anthrone
Molecular FormulaC15H12O4
Molecular Weight256.26
Purity98.00%
Density1.471 g/cm3
Boiling Point556.2ºC at 760 mmHg
Melting Point254-258 °C(dec.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 491-60-1 |
| Catalog No. | 2A-9022228 |
| Chinese Name | 大黄素蒽酮 |
| Synonyms | 1,3,8-Trihydroxy-6-methyl-anthron; 6-methyl-1,3,8-trihydroxy-10H-anthracene-9-one; Emodinanthrone; 1,3,8-trihydroxy-6-methyl-anthrone |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 |
| Purity | 98.00 |
| Density | 1.471 g/cm3 |
| Boiling Point | 556.2ºC at 760 mmHg |
| Melting Point | 254-258 °C(dec.) |
| Storage Condition | 2-8°C, dry, sealed |
| Application | Emodin anthrone is an anthraquinone, a derivative of emodin that has antibacterial activity. Emodin anthrone inhibits respiration-driven solute transport at micromolar concentrations in membrane vesic |
| MDL Number | MFCD09955502 |
| SMILES | Cc1cc(O)c2c(c1)Cc1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C15H12O4/c1-7-2-8-4-9-5-10(16)6-12(18)14(9)15(19)13(8)11(17)3-7/h2-3,5-6,16-18H,4H2,1H3 |
| InChI Key | LAJSXCAVRQXZIO-UHFFFAOYSA-N |
| MSDS | msds/22228_1_491_60_1.pdf |
| Transport Info | Product name: Emodin anthrone |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Isoimperatorin | 482-45-1 | 2A-9022164 |
| (+)-Bicuculline | 485-49-4 | 2A-9022183 |
| 3-Indoxyl-beta-D-glucopyranoside | 487-60-5 | 2A-9022202 |
| L-Epicatechin | 490-46-0 | 2A-9022218 |
| Quercetin-7-glucoside | 491-50-9 | 2A-9022227 |
| Baicalein | 491-67-8 | 2A-9022229 |
| Luteolin | 491-70-3 | 2A-9022230 |
| Rhapontigenin | 500-65-2 | 2A-9022309 |
| Sennosides | 517-43-1 | 2A-9022444 |
| Emodin | 518-82-1 | 2A-9022455 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA