
CAS Number130-84-7
SynonymsDIMETHYL (Z)-2,3-DIACETYLOXYBUT-2-ENEDIOATE; Diacetoxy-fumaric acid dimethyl ester; Fumaric acid,dihydroxy-,dimethyl ester,diacetate; (E)-2,3-Bis(acetyloxy)-2-butenedioic acid dimethyl ester; Diacetoxy-fuMaric Acid DiMethyl Ester (DAF); Diacetoxy-fumarsaeure-dimethylester; Dihydroxyfumaric acid dimethyl ester diacetate; dimethyl 2,3-diacetoxyfumarate
Molecular FormulaC10H12O8
Molecular Weight260.19700
Purity98.00%
Density1.296
Boiling Point322.8ºC at 760mmHg
Melting Point102-105ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 130-84-7 |
| Catalog No. | 2A-9020655 |
| Chinese Name | 二乙酰氧基富马酸二甲酯 |
| Synonyms | DIMETHYL (Z)-2,3-DIACETYLOXYBUT-2-ENEDIOATE; Diacetoxy-fumaric acid dimethyl ester; Fumaric acid,dihydroxy-,dimethyl ester,diacetate; (E)-2,3-Bis(acetyloxy)-2-butenedioic acid dimethyl ester; Diacetoxy-fuMaric Acid DiMethyl Ester (DAF); Diacetoxy-fumarsaeure-dimethylester; Dihydroxyfumaric acid dimethyl ester diacetate; dimethyl 2,3-diacetoxyfumarate |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.19700 |
| Purity | 98.00 |
| Density | 1.296 |
| Boiling Point | 322.8ºC at 760mmHg |
| Melting Point | 102-105ºC |
| HTC | 2918990090 |
| SMILES | COC(=O)C(OC(C)=O)=C(OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C10H12O8/c1-5(11)17-7(9(13)15-3)8(10(14)16-4)18-6(2)12/h1-4H3/b8-7- |
| InChI Key | NKGXGEHGPYWBDK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium 1-naphthalenesulfonate | 130-14-3 | 2A-9020644 |
| Vat Blue 6 | 130-20-1 | 2A-9020648 |
| Alizarin Red S | 130-22-3 | 2A-9020649 |
| 1-Amino-8-naphthol-4,6-disulfonic acid | 130-23-4 | 2A-9020650 |
| Menadione sodium bisulfite | 130-37-0 | 2A-9020652 |
| Pamoic acid | 130-85-8 | 2A-0202222 |
| (-)-Berbine | 131-10-2 | 2A-9020663 |
| Dimethyl phthalate | 131-11-3 | 2A-9020664 |
| Pimpinellin | 131-12-4 | 2A-9020665 |
| 2-Amino-4,8-naphthalenedisulfonic acid | 131-27-1 | 2A-9020668 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA