
CAS Number130-23-4
Synonyms8-amino-1-hydroxynaphthalene-3,5-disulphonic acid; 1-amino-8-hydroxy-naphthalene-4,6-disulphonic acid; 4-Amino-5-hydroxynaphthalene-1,7-disulfonic acid; 4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid; 1-hydroxy-8-aminonaphthalene-3,5-disulphonic acid; 1 AMINO 8 HYDROXY 4:6 DISULFONIC ACID; 5-hydroxy-4-aminonaphthalene-1,7-disulphonic acid; 4-amino-5-hydroxy-naphthalene-1,7-disulphonic acid; MFCD00035711; K Acid; 4-Amino-5-naphthol-1,7-disulfonic acid; EINECS 204-982-3; 1-amino-8-naphtho-4,6-Disulfonic acid; EUROPEAN K-ACID; 8-AMINO-1-NAPHTHOL-3,5-DISULFONIC ACID
Molecular FormulaC10H9NO7S2
Molecular Weight341.29
Purity98.00%
Density1.9±0.1 g/cm3
Melting Point>380 °C
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 130-23-4 |
| Catalog No. | 2A-9020650 |
| Chinese Name | 1-氨基-8-萘酚-4,6-二磺酸 |
| Synonyms | 8-amino-1-hydroxynaphthalene-3,5-disulphonic acid; 1-amino-8-hydroxy-naphthalene-4,6-disulphonic acid; 4-Amino-5-hydroxynaphthalene-1,7-disulfonic acid; 4-Amino-5-hydroxy-1,7-naphthalenedisulfonic acid; 1-hydroxy-8-aminonaphthalene-3,5-disulphonic acid; 1 AMINO 8 HYDROXY 4:6 DISULFONIC ACID; 5-hydroxy-4-aminonaphthalene-1,7-disulphonic acid; 4-amino-5-hydroxy-naphthalene-1,7-disulphonic acid; MFCD00035711; K Acid; 4-Amino-5-naphthol-1,7-disulfonic acid; EINECS 204-982-3; 1-amino-8-naphtho-4,6-Disulfonic acid; EUROPEAN K-ACID; 8-AMINO-1-NAPHTHOL-3,5-DISULFONIC ACID |
| Molecular Formula | C10H9NO7S2 |
| Molecular Weight | 341.29 |
| Purity | 98.00 |
| Density | 1.9±0.1 g/cm3 |
| Melting Point | >380 °C |
| Appearance | powder |
| Storage Condition | Room temperature, protected from light, inert gas |
| HTC | 2922299090 |
| MDL Number | MFCD00036444 |
| SMILES | [Na+].[S](=O)(=O)(O)c1cc2c(c(c1)N)c(cc(c2)[S](=O)(=O)O)[O-] |
| InChI | 1S/C10H9NO7S2.Na/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8;/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18);/q;+1/p-1 |
| InChI Key | QPILZZVXGUNELN-UHFFFAOYSA-M |
| NACRES Code | NA.22 |
| UNSPSC | 12352107 |
| MSDS | msds/20650_1_130_23_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benz[cd]indol-2(1H)-one | 130-00-7 | 2A-9020642 |
| Sodium 4-amino-1-naphthalenesulfonate | 130-13-2 | 2A-9020643 |
| Sodium 1-naphthalenesulfonate | 130-14-3 | 2A-9020644 |
| Vat Blue 6 | 130-20-1 | 2A-9020648 |
| Alizarin Red S | 130-22-3 | 2A-9020649 |
| Menadione sodium bisulfite | 130-37-0 | 2A-9020652 |
| Dimethyl diacetoxyfumarate | 130-84-7 | 2A-9020655 |
| Pamoic acid | 130-85-8 | 2A-0202222 |
| (-)-Berbine | 131-10-2 | 2A-9020663 |
| Dimethyl phthalate | 131-11-3 | 2A-9020664 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA