
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 120-98-9 |
| Catalog No. | 2A-9019105 |
| Chinese Name | 5-氨基-4-羟基-1, 3-苯二磺酸 |
| Synonyms | MFCD00035911; 5-amino-4-hydroxybenzene-1,3-disulfonic acid; 5-Amino-4-hydroxy-1,3-benzenedisulfonic acid; EINECS 204-441-1 |
| Molecular Formula | C6H7NO7S2 |
| Molecular Weight | 269.252 |
| Purity | 98.00 |
| Density | 2.0±0.1 g/cm3 |
| Melting Point | 170 °C |
| Appearance | solid |
| Storage Condition | room temperature, dry |
| HTC | 2922299090 |
| SMILES | Nc1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C6H7NO7S2/c7-4-1-3(15(9,10)11)2-5(6(4)8)16(12,13)14/h1-2,8H,7H2,(H,9,10,11)(H,12,13,14) |
| InChI Key | HTYRTGGIOAMLRR-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Phenylethyl propionate | 120-45-6 | 2A-9019084 |
| Dibenzoylmethane | 120-46-7 | 2A-9019085 |
| Benzyl benzoate | 120-51-4 | 2A-9019087 |
| Bis(pentamethylene)thiuram tetrasulfide | 120-54-7 | 2A-9019088 |
| Diclofenamide | 120-97-8 | 2A-9019104 |
| 2-Methyl-5-nitrobenzenesulfonic acid | 121-03-9 | 2A-9019108 |
| 2-Aminoethyldiisopropylamine | 121-05-1 | 2A-9019109 |
| 4-Chloro-3-nitrobenzotrifluoride | 121-17-5 | 2A-9019111 |
| 4-Chloro-3-nitrobenzenesulfonic acid | 121-18-6 | 2A-9019112 |
| Roxarsone | 121-19-7 | 2A-9019113 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA