
CAS Number121-18-6
Synonyms2-Nitrochlorobenzene-4-sulfonic acid; 3-nitro-4-chlorobenzenesulphonic acid; o-Nitrochlorobenzene-p-sulfonic acid; 3-Nitro-4-chlorobenzenesulfonic acid; Benzenesulfonic acid,4-chloro-3-nitro; 4-chloro-3-nitrobenzene sulfonic acid; EINECS 204-452-1; MFCD00274152; 4-sulfo-2-nitrochlorobenzene
Molecular FormulaC6H4ClNO5S
Molecular Weight237.619
Purity98.00%
Density1.747 g/cm3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 121-18-6 |
| Catalog No. | 2A-9019112 |
| Chinese Name | 4-氯-3-硝基苯磺酸 |
| Synonyms | 2-Nitrochlorobenzene-4-sulfonic acid; 3-nitro-4-chlorobenzenesulphonic acid; o-Nitrochlorobenzene-p-sulfonic acid; 3-Nitro-4-chlorobenzenesulfonic acid; Benzenesulfonic acid,4-chloro-3-nitro; 4-chloro-3-nitrobenzene sulfonic acid; EINECS 204-452-1; MFCD00274152; 4-sulfo-2-nitrochlorobenzene |
| Molecular Formula | C6H4ClNO5S |
| Molecular Weight | 237.619 |
| Purity | 98.00 |
| Density | 1.747 g/cm3 |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2904909090 |
| MDL Number | MFCD00274152 |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)O)ccc1Cl |
| InChI | InChI=1S/C6H4ClNO5S/c7-5-2-1-4(14(11,12)13)3-6(5)8(9)10/h1-3H,(H,11,12,13) |
| InChI Key | RPKWNMFDAOACCX-UHFFFAOYSA-N |
| MSDS | msds/19112_1_121_18_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diclofenamide | 120-97-8 | 2A-9019104 |
| 5-Amino-4-hydroxybenzene-1,3-disulphonic acid | 120-98-9 | 2A-9019105 |
| 2-Methyl-5-nitrobenzenesulfonic acid | 121-03-9 | 2A-9019108 |
| 2-Aminoethyldiisopropylamine | 121-05-1 | 2A-9019109 |
| 4-Chloro-3-nitrobenzotrifluoride | 121-17-5 | 2A-9019111 |
| Roxarsone | 121-19-7 | 2A-9019113 |
| Amprolium | 121-25-5 | 2A-9019114 |
| 4-Amino-6-chlorobenzene-1,3-disulfonamide | 121-30-2 | 2A-9019116 |
| Trimethyl borate | 121-43-7 | 2A-0200654 |
| 3-Cyclopropylmethoxy-4-difluoromethoxy-benzoic acid | 162401-62-9 | 2A-9019123 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA