CAS Number2055-97-2
SynonymsTFA 4; 3.5-Dijod-4-(3.5-dijod-4-oxy-phenoxy)-benzoesaeure; 4-(4-hydroxy-3,5-diiodo-phenoxy)-3,5-diiodo-benzoic acid; 3,3',5,5'-Tetraiodothyroformic acid; 2.6.3'.5'-Tetrajod-4'-oxy-diphenylaether-carbonsaeure-(4); 4-(4-Hydroxy-3,5-dijod-phenoxy)-3,5-dijod-benzoesaeure; Tetraiodothyroformic Acid; Tetrajod-thyroameisensaeure
Molecular FormulaC13H8I2O4
Molecular Weight733.80
Density2.83g/cm3
Boiling Point525.4ºC at 760mmHg
Melting Point236-239ºC (dec.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2055-97-2 |
| Catalog No. | 2A-3177838 |
| Chinese Name | 4-(4-羟基-3,5-二碘苯氧基)-3,5-二碘苯甲酸 |
| Synonyms | TFA 4; 3.5-Dijod-4-(3.5-dijod-4-oxy-phenoxy)-benzoesaeure; 4-(4-hydroxy-3,5-diiodo-phenoxy)-3,5-diiodo-benzoic acid; 3,3',5,5'-Tetraiodothyroformic acid; 2.6.3'.5'-Tetrajod-4'-oxy-diphenylaether-carbonsaeure-(4); 4-(4-Hydroxy-3,5-dijod-phenoxy)-3,5-dijod-benzoesaeure; Tetraiodothyroformic Acid; Tetrajod-thyroameisensaeure |
| Molecular Formula | C13H8I2O4 |
| Molecular Weight | 733.80 |
| Density | 2.83g/cm3 |
| Boiling Point | 525.4ºC at 760mmHg |
| Melting Point | 236-239ºC (dec.) |
| Storage Condition | 2-8°C, protected from light, filled with argon |
| HTC | 2918990090 |
| SMILES | O=C(O)c1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C13H6I4O4/c14-7-3-6(4-8(15)11(7)18)21-12-9(16)1-5(13(19)20)2-10(12)17/h1-4,18H,(H,19,20) |
| InChI Key | HKJUOMPYMPXLFS-UHFFFAOYSA-N |
| UNSPSC | 41116107 |
| MSDS | msds/178440_1_2055_97_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Analytical Standards | ||
|---|---|---|
| Ketoconazole Impurity C | 83374-59-8 | 2A-3177807 |
| LATANOPROST ACID IMPURITY | 2088449-88-9 | 2A-3177829 |
| Lenalidomide Impurity A | 98475-07-01 | 2A-3177830 |
| Lercanidipine Dimethyl ester impurity oxalate salt | 957214-95-8 | 2A-3177833 |
| Levobupivacaine Impurity C | 1797894-80-4 | 2A-3177836 |
| Levothyroxine EP Impurity I | 2016-06-0 | 2A-3177839 |
| Levothyroxine EP Impurity K | 5817-39-0 | 2A-3177840 |
| Levothyroxine EP impurity D | 67-30-1 | 2A-3177842 |
| Linagliptin impurity N | 2A-3177845 | 2A-3177845 |
| Linagliptin Impurity V | 2A-3177846 | 2A-3177846 |
| Browse all Analytical Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS