
CAS Number1626387-80-1
Synonyms(R)-4-((3-chloro-2-fluorophenyl)amino)-7-methoxyquinazolin-6-yl 2,4-dimethylpiperazine-1-carboxylate; AZD-3759
Molecular FormulaC22H23ClFN5O3
Molecular Weight459.901
Purity98%%
Density1.4±0.1 g/cm3
Boiling Point571.4±50.0 °C at 760 mmHg
Melting Point192.4 °C(醇、酯), 193.3 °C (水)
AppearanceWhite or off-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1626387-80-1 |
| Catalog No. | 2A-1170973 |
| Chinese Name | AZD-3759 |
| Synonyms | (R)-4-((3-chloro-2-fluorophenyl)amino)-7-methoxyquinazolin-6-yl 2,4-dimethylpiperazine-1-carboxylate; AZD-3759 |
| Molecular Formula | C22H23ClFN5O3 |
| Molecular Weight | 459.901 |
| Purity | 98% |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 571.4±50.0 °C at 760 mmHg |
| Melting Point | 192.4 °C(醇、酯), 193.3 °C (水) |
| Appearance | White or off-white solid |
| Water Solubility | Dissolve in DMSO |
| Storage Condition | -20℃ |
| Application | AZD3759 is a potent CNS-permeable EGFR inhibitor. For EGFRwt, EGFRL858R and EGFRexon 19Del, the IC50 is 0.3, 0.2 and 0.2 nM respectively. |
| PubChem ID | 207761305 |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1OC(=O)N1CCN(C)CC1C |
| InChI | InChI=1S/C22H23ClFN5O3/c1-13-11-28(2)7-8-29(13)22(30)32-19-9-14-17(10-18(19)31-3)25-12-26-21(14)27-16-6-4-5-15(23)20(16)24/h4-6,9-10,12-13H,7-8,11H2,1-3H3,(H,25,26,27)/t13-/m1/s1 |
| InChI Key | MXDSJQHFFDGFDK-CYBMUJFWSA-N |
| Transport Info | Product name: AZD3759 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-(5-(5-amino-6-(5-(tert-butyl)-1,3,4-oxadiazol-2-yl)pyrazin-2-yl)-1-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl)-3-hydroxypropan-1-one | 1620576-64-8 | 2A-1170967 |
| IMISOPASEM MANGANESE | 218791-21-0 | 2A-1170969 |
| MDL 72274A | 85278-24-6 | 2A-1170970 |
| RSM932A | 850807-63-5 | 2A-1170971 |
| GDC-0810(ARN-810) | 1365888-06-7 | 2A-1170972 |
| MP-412 | 451492-95-8 | 2A-1170974 |
| 1H-Pyrazolo[3,4-b]pyridin-4-ol, 1-[(4-Methoxyphenyl)Methyl]- | 924909-16-0 | 2A-1170976 |
| PD 0332991 HCl | 827022-32-2 | 2A-1170977 |
| PACRITINIB | 937272-79-2 | 2A-1170978 |
| IDO inhibitor 1 | 1204669-37-3 | 2A-1170979 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA