
CAS Number850807-63-5
Synonyms1,1'-(biphenyl-4,4'-diylmethylene)bis[4-(4-chloro-N-methylanilino)quinolinium] dibromide; RSM-932A; 1,1'-([1,1'-biphenyl]-4,4'-diylbis(methylene))bis(4-(methyl(p-tolyl)amino)quinolin-1-ium) bromide
Molecular FormulaC46H38Br2Cl2N4
Molecular Weight877.53500
Purity98%%
Melting Point255 - 257 °C
AppearanceLight yellow solid powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 850807-63-5 |
| Catalog No. | 2A-1170971 |
| Chinese Name | RSM-932A |
| Synonyms | 1,1'-(biphenyl-4,4'-diylmethylene)bis[4-(4-chloro-N-methylanilino)quinolinium] dibromide; RSM-932A; 1,1'-([1,1'-biphenyl]-4,4'-diylbis(methylene))bis(4-(methyl(p-tolyl)amino)quinolin-1-ium) bromide |
| Molecular Formula | C46H38Br2Cl2N4 |
| Molecular Weight | 877.53500 |
| Purity | 98% |
| Melting Point | 255 - 257 °C |
| Appearance | Light yellow solid powder |
| Storage Condition | -20°C, sealed, dry |
| Application | RSM-932A (TCD-717) is a specific ChoKα inhibitor with IC50s of 1 and 33 μM, respectively, for human recombinant ChoKα and ChoKβ enzymes. RSM-932A is the "first in humans" compound targeting ChoKα. RSM |
| PubChem ID | 16323870 |
| SMILES | CN(c1ccc(Cl)cc1)c1cc[n+](Cc2ccc(-c3ccc(C[n+]4ccc(N(C)c5ccc(Cl)cc5)c5ccccc54)cc3)cc2)c2ccccc12.[Br-].[Br-] |
| InChI | InChI=1S/C46H38Cl2N4.2BrH/c1-49(39-23-19-37(47)20-24-39)43-27-29-51(45-9-5-3-7-41(43)45)31-33-11-15-35(16-12-33)36-17-13-34(14-18-36)32-52-30-28-44(42-8-4-6-10-46(42)52)50(2)40-25-21-38(48)22-26-40;;/h3-30H,31-32H2,1-2H3;2*1H/q+2;;/p-2 |
| InChI Key | DGBVSSXGHKAASQ-UHFFFAOYSA-L |
| Transport Info | Product name: RSM-932A |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| AMG 925 | 1401033-86-0 | 2A-1170965 |
| AMG319 | 1608125-21-8 | 2A-1170966 |
| 1-(4-(5-(5-amino-6-(5-(tert-butyl)-1,3,4-oxadiazol-2-yl)pyrazin-2-yl)-1-ethyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl)-3-hydroxypropan-1-one | 1620576-64-8 | 2A-1170967 |
| IMISOPASEM MANGANESE | 218791-21-0 | 2A-1170969 |
| MDL 72274A | 85278-24-6 | 2A-1170970 |
| GDC-0810(ARN-810) | 1365888-06-7 | 2A-1170972 |
| AZD 3759 | 1626387-80-1 | 2A-1170973 |
| MP-412 | 451492-95-8 | 2A-1170974 |
| 1H-Pyrazolo[3,4-b]pyridin-4-ol, 1-[(4-Methoxyphenyl)Methyl]- | 924909-16-0 | 2A-1170976 |
| PD 0332991 HCl | 827022-32-2 | 2A-1170977 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA