![Octanoic acid, 6,8-bis[(phenylMethyl)thio]- structure, CAS 95809-78-2](/structures/180000/171114_2_95809_78_2.png)
CAS Number95809-78-2
Synonyms6,8-bis-benzylsulfanyl-octanoic acid; 6,8-Bis(benzylsulfanyl)octanoic acid; 6,8-Bis-benzylmercapto-octansaeure; 6,8-bis-benzylthio-octanoic acid; cc-429; QCR-193; (±)6,8-bis-thiobenzyl octanoic acid; CPI 613; UNII:E76113IR49; CPI-613; 6,8-Bis(benzylthio)octanoic acid
Molecular FormulaC22H28O2S2
Molecular Weight388.586
Purity98%%
Density1.1±0.1 g/cm3
Boiling Point553.0±50.0 °C at 760 mmHg
Melting Point63-65℃
Appearancewhite to beige
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 95809-78-2 |
| Catalog No. | 2A-1170932 |
| Chinese Name | 6,8-双(苄基硫代)辛酸 |
| Synonyms | 6,8-bis-benzylsulfanyl-octanoic acid; 6,8-Bis(benzylsulfanyl)octanoic acid; 6,8-Bis-benzylmercapto-octansaeure; 6,8-bis-benzylthio-octanoic acid; cc-429; QCR-193; (±)6,8-bis-thiobenzyl octanoic acid; CPI 613; UNII:E76113IR49; CPI-613; 6,8-Bis(benzylthio)octanoic acid |
| Molecular Formula | C22H28O2S2 |
| Molecular Weight | 388.586 |
| Purity | 98% |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 553.0±50.0 °C at 760 mmHg |
| Melting Point | 63-65℃ |
| Appearance | white to beige |
| Water Solubility | DMSO: soluble15mg/mL (clear solution) |
| Storage Condition | 2-8°C |
| Application | CPI-613 is a lipoic acid analog that inhibits pyruvate dehydrogenase (PDH) and alpha-ketoglutarate dehydrogenase, disrupts mitochondrial metabolism and displays potent anti-tumor activity. |
| PubChem ID | 49691904 |
| SMILES | O=C(O)CCCCC(CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C22H28O2S2/c23-22(24)14-8-7-13-21(26-18-20-11-5-2-6-12-20)15-16-25-17-19-9-3-1-4-10-19/h1-6,9-12,21H,7-8,13-18H2,(H,23,24) |
| InChI Key | ZYRLHJIMTROTBO-UHFFFAOYSA-N |
| Transport Info | Product name: 6,8-bis(benzylthio)octanoic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Potassium 3-trifluoroboratopropionate methyl ester | 1023357-63-2 | 2A-1170924 |
| 2,2-Dimethylpropyltrifluoroborate potassium salt | 1150655-02-9 | 2A-1170925 |
| Potassium cyclohexene-1-trifluoroborate | 1186667-20-8 | 2A-1170928 |
| EX-527 (R-enantioMer) | 848193-69-1 | 2A-1170930 |
| EX527 | 848193-68-0 | 2A-1170931 |
| Golvatinib (E7050) | 928037-13-2 | 2A-1170933 |
| N-[3-tert-Butyl-1-(quinolin-6-yl)-1H-pyrazol-5-yl]-N'-[2-fluoro-4-[(2-(methylcarbamoyl)pyridin-4-yl)oxy]phenyl]urea | 1020172-07-9 | 2A-1170935 |
| PD0332991 Isethionate | 827022-33-3 | 2A-1170936 |
| LY2835219 | 1231930-82-7 | 2A-1170938 |
| SU 5416 | 204005-46-9 | 2A-1170940 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA